Isovallesiachotamine

Catalog Number	ACM34384719
CAS Number	34384-71-9
Structure
Synonyms	(Z)-Vallesiachotamine
Molecular Weight	350.4
InChI	InChI=1S/C21H22N2O3/c1-3-13(12-24)16-10-19-20-15(14-6-4-5-7-18(14)22-20)8-9-23(19)11-17(16)21(25)26-2/h3-7,11-12,16,19,22H,8-10H2,1-2H3/b13-3+/t16-,19-/m0/s1
InChI Key	NTVLUSJWJRSPSM-AHHXMMTISA-N
Melting Point	233-236 °C
Purity	95%+
Complexity	641
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	350.16304257
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C(\C=O)/[C@@H]1C[C@H]2C3=C(CCN2C=C1C(=O)OC)C4=CC=CC=C4N3
Monoisotopic Mass	350.16304257
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	62.4 Ų

Custom Q&A

What is the chemical formula of Isovallesiachotamine?

The chemical formula of Isovallesiachotamine is C21H22N2O3.

What is the molecular weight of Isovallesiachotamine?

The molecular weight of Isovallesiachotamine is 350.41.

What is the CAS number for Isovallesiachotamine?

The CAS number for Isovallesiachotamine is 34384-71-9.

What is the melting point of Isovallesiachotamine?

The melting point of Isovallesiachotamine is 233-236 °C.

In what solvents is Isovallesiachotamine soluble?

Isovallesiachotamine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of Isovallesiachotamine?

The predicted boiling point of Isovallesiachotamine is 566.8±50.0 °C.

What is the predicted density of Isovallesiachotamine?

The predicted density of Isovallesiachotamine is 1.28±0.1 g/cm3.

What is the predicted pka value of Isovallesiachotamine?

The predicted pka value of Isovallesiachotamine is 17.46±0.60.

What is the form of Isovallesiachotamine?

Isovallesiachotamine is in the form of powder.

What are some synonyms for Isovallesiachotamine?

Some synonyms for Isovallesiachotamine are (Z)-Vallesiachotamine, 17-Isovallesiachotamine, and Indolo[2,3-a]quinolizine-3-carboxylic acid, 2-[(1Z)-1-formyl-1-propen-1-yl]-1,2,6,7,12,12b-hexahydro-, methyl ester, (2S,12bS)-.

※ Please kindly note that our products are for research use only.