Isoverticine

Catalog Number	ACM23496437
CAS Number	23496-43-7
Structure
Synonyms	Isopeimine
Molecular Weight	431.7
InChI	InChI=1S/C27H45NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-25,29-31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21-,22-,23+,24+,25-,26+,27-/m0/s1
InChI Key	IUKLSMSEHKDIIP-RZNVUHDWSA-N
Purity	95%+
Complexity	715
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	13
Exact Mass	431.3399443
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@H]1CC[C@H]2[C@@]([C@H]3CC[C@@H]4[C@H]([C@@H]3CN2C1)C[C@H]5[C@H]4C[C@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O)(C)O
Monoisotopic Mass	431.3399443
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	63.9 Ų

Custom Q&A

What is the chemical name of Isoverticine?

Isoverticine's chemical name is Cevane-3,6,20-triol, (3b,5a,6b)-.

What are some synonyms for Isoverticine?

Some synonyms for Isoverticine are Isopeimine and Cevane-3,6,20-triol, (3b,5a,6b)-.

What is the CAS number for Isoverticine?

The CAS number for Isoverticine is 23496-43-7.

What is the molecular formula of Isoverticine?

The molecular formula of Isoverticine is C27H45NO3.

What is the molecular weight of Isoverticine?

The molecular weight of Isoverticine is 431.6511.

In what category does Isoverticine fall under?

Isoverticine falls under the category of Cevane-3,6,20-triol.

How many nitrogen atoms are present in the molecular formula of Isoverticine?

There is one nitrogen atom present in the molecular formula of Isoverticine.

What is the structure of Isoverticine?

The structure of Isoverticine includes three oxygen atoms and one nitrogen atom in addition to carbon and hydrogen atoms.

What is the significance of Isoverticine in chemical and pharmaceutical industries?

Isoverticine has potential applications in chemical and pharmaceutical industries due to its unique structure and properties.

※ Please kindly note that our products are for research use only.