Jatrorrhizine

Jatrorrhizine

Inquiry
Catalog Number ACM3621383
CAS Number 3621-38-3
Structure
Synonyms 2,9,10-Trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol
Molecular Weight 338.4
InChI InChI=1S/C20H19NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,8-11H,6-7H2,1-3H3/p+1
InChI Key MXTLAHSTUOXGQF-UHFFFAOYSA-O
Melting Point 208-210 °C
Purity 95%+
Complexity 461
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 338.13923312
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 338.13923312
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 51.8 Ų
Custom Q&A

What is the chemical name of Jatrorrhizine?

The chemical name of the compound referenced is 2,9,10-Trimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-3-ol.

What are some synonyms for the compound?

Some synonyms for the compound are Jatrorrhizin, Neprotin, Yatrorizine, and Neprotine.

What is the CAS number of the compound?

The CAS number of the compound is 3621-38-3.

What is the molecular formula of the compound?

The molecular formula of the compound is C20H20INO4.

What is the melting point of the compound?

The melting point of the compound is 208-210°C.

How should the compound be stored?

The compound should be stored in an inert atmosphere at 2-8°C.

What is the solubility of the compound in methanol?

The compound is slightly soluble in methanol when heated.

What color is the compound?

The compound is orange in color.

What is one of the safety hazards associated with the compound?

The compound is associated with hazard code N and risk statement 50.

What is one use of jatrorrhizine, the alkaloid extract from Berberidaceae family of plants?

Jatrorrhizine displays antioxidant activity, making it useful in that regard.

※ Please kindly note that our products are for research use only.