Jesaconitine

Jesaconitine

Inquiry
Catalog Number ACM16298901
CAS Number 16298-90-1
Structure
Description Jesaconitine is a natural compound that has been shown to have anti-inflammatory properties. It has been shown to inhibit the activity of cyclooxygenase and lipoxygenase enzymes, which are involved in the production of prostaglandins. Jesaconitine also inhibits the expression of nuclear DNA and suppresses myeloma cells by inhibiting their ability to synthesize proteins. Jesaconitine has also been shown to inhibit chronic arthritis in animal models by suppressing inflammation and preventing joint damage. This compound is not active against nonsteroidal anti-inflammatory drugs such as ibuprofen, diclofenac, and naproxen. Jesaconitine can be extracted from the plant Angelica Dahurica or synthesized in laboratories. It is soluble in trifluoroacetic acid (TFA) and can be analyzed using nuclear magnetic resonance spectroscopy with high values for matrix effect and control analysis.
Synonyms Diesaconitine(1a,3a,6a,14a,15a,16b)-20-Ethyl-1,6,16-triMethoxy-4-(MethoxyMethyl)-aconitane-3,8,13,14,15-pentol 8-Acetate 14-(4-Meth oxybenzoate)
Molecular Weight 675.76 g/mol
Molecular Formula C35H49NO12
Canonical SMILES CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6OC(=O)C7=CC=C(C=C7)OC)([C@H]([C@@H]5O)OC)O)OC(=O)C)OC)OC)O)COC
Storage store at 2℃-8℃
Harmonized Tariff Code Switzerland: 29334900 - USA: 2933496000 - Slovakia: 2933499090 - UK: 2933499090 - China: 2933490090
MDL Number MFCD00221752
Custom Q&A

What is the chemical formula for Guayewuanine B?

The chemical formula for Guayewuanine B is C35H49NO12.

At what temperature does Guayewuanine B melt?

Guayewuanine B has a melting point of 128-131°C.

What is Guayewuanine B used for?

Guayewuanine B is a aconite alkaloid present in Aconitum plants and is highly toxic, causing respiratory paralysis and toxic action on the heart.

How can Guayewuanine B be hydrolyzed?

Boiling dilute H2SO4 causes hydrolysis of Guayewuanine B to produce acetic acid and jesanisaconine.

What does oxidation with KMn04 yield when applied to Guayewuanine B?

Oxidation with KMn04 yields acetaldehyde, indicating the presence of an ethylimino group in Guayewuanine B.

Which alkaloid is similar to Guayewuanine B and has been isolated from Aconitum hemsleyanum?

A complex aconitine alkaloid, yunaconitine, has been isolated from Aconitum hemsleyanum.

When was the structure of Guayewuanine B determined?

The structure of Guayewuanine B was determined through continuous monitoring of pyrolysis and an examination of the products produced.

What type of salts can Guayewuanine B form?

Guayewuanine B can form crystalline salts such as the perchlorate, aurichloride, and perbromide.

What toxic effects does Guayewuanine B have on the body?

Guayewuanine B is highly toxic, causing respiratory paralysis and a direct toxic action on the heart, often leading to ventricular fibrillation.

Who conducted research on Guayewuanine B and its structure?

Research on Guayewuanine B and its structure was conducted by Keith and Pelletier in various publications between 1967 and 1968.

※ Please kindly note that our products are for research use only.