L-Carnitine

Catalog Number	ACM541151-5
CAS Number	541-15-1
Synonyms	Levocarnitine
IUPAC Name	(3R)-3-Hydroxy-4-(trimethylazaniumyl)butanoate
Molecular Weight	161.20
Molecular Formula	C7H15NO3
Canonical SMILES	C[N+](C)(C)CC(CC(=O)[O-])O
InChI	InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1
InChI Key	PHIQHXFUZVPYII-ZCFIWIBFSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	134
Exact Mass	161.10519334
Heavy Atom Count	11
Isomeric SMILES	C[N+](C)(C)C[C@@H](CC(=O)[O-])O
Monoisotopic Mass	161.10519334
Topological Polar Surface Area	60.4Ų

Custom Q&A

What is the chemical formula of L-carnitine?

The chemical formula of L-carnitine is C7H15NO3.

What is the melting point of L-carnitine?

The melting point of L-carnitine is 197-212 °C.

What is the main function of L-carnitine in the body?

L-carnitine promotes the conversion of fat into energy.

What are some indications and usage of L-carnitine?

L-carnitine is used to help transport long-chain fatty acids, prevent fat accumulation in the heart, liver, and skeletal muscles, and aid in weight loss.

How is L-carnitine absorbed in the body?

L-carnitine can be entirely absorbed by the human body when consumed through food, and it can also be synthesized by the liver and kidneys.

What enzymes are involved in the transportation of fatty acids by L-carnitine into the mitochondrial membrane?

Carnitine acyl-CoA transferases I and II are the key enzymes involved in this process.

What is the main mechanism of action of L-carnitine?

L-carnitine promotes fatty acid beta oxidation in the liver and mitochondria of other tissue cells.

What are some safety considerations for L-carnitine?

L-carnitine is considered an irritant and has been shown to have low toxicity in animal studies.

What are some uses of L-carnitine in different industries?

L-carnitine is used as an animal nutrition enhancer, in infant foods, sports nutrition products, and weight loss foods.

How is L-carnitine synthesized in the body?

L-carnitine is synthesized primarily in the liver and kidneys from lysine, methionine, vitamin C, nicotinic acid, and vitamin B6.

※ Please kindly note that our products are for research use only.