L-Glutamic acid

Catalog Number	ACM56860
CAS Number	56-86-0
Structure
Synonyms	L-Glutanmic
IUPAC Name	(2S)-2-Aminopentanedioic acid
Molecular Weight	147.13
Molecular Formula	C5H9NO4
Canonical SMILES	C(CC(=O)O)C(C(=O)O)N
InChI	InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1
InChI Key	WHUUTDBJXJRKMK-VKHMYHEASA-N
Boiling Point	267.21 °C
Melting Point	205 °C(lit.)
Flash Point	155.7 °C
Purity	99%
Density	1.54 g/cm³ at 20 °C
Solubility	Slight soluble in water, ether
Appearance	Solid
Storage	2-8 °C
Complexity	145
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
EC Number	200-293-7
Exact Mass	147.05315777
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	3
Isomeric SMILES	C(CC(=O)O)[C@@H](C(=O)O)N
MDL Number	MFCD00002634
Monoisotopic Mass	147.05315777
PhysicalState	Solid
Rotatable Bond Count	4
Topological Polar Surface Area	101 Ų

Custom Q&A

What is the chemical formula for L-Glutamic acid?

The chemical formula for L-Glutamic acid is C5H9NO4.

What is the molecular weight of L-Glutamic acid?

The molecular weight of L-Glutamic acid is 147.13 g/mol.

What is the melting point of L-Glutamic acid?

The melting point of L-Glutamic acid is 205 °C (dec.) (lit.).

What is the Boiling point of L-Glutamic acid?

The Boiling point of L-Glutamic acid is approximately 267.21°C.

What are the commonly used synonyms for L-Glutamic acid?

Some commonly used synonyms for L-Glutamic acid are Acidum glutamicum, Glu, and (S)-2-Aminopentanedioic acid.

What is the pH range of L-Glutamic acid in water at 25°C?

The pH of L-Glutamic acid in water is in the range of 3.0-3.5 at 25°C.

How is L-Glutamic acid used in the food industry?

L-Glutamic acid is used as a food additive, flavor enhancer, and salt substitute in the food industry.

What is the optical activity of L-Glutamic acid in 2 M HCl?

The optical activity of L-Glutamic acid in 2 M HCl is [α]20/D +32°, c = 10.

How is L-Glutamic acid produced industrially?

L-Glutamic acid is produced through microbial fermentation using carbohydrates as raw materials and separation techniques such as "Isoelectric point extraction" and "ion exchange resin".

How does L-Glutamic acid play a role in the metabolic pathways of animals and plants?

L-Glutamic acid participates in amino acid biosynthesis, ammonia transport, and acts as a precursor for the synthesis of important amino acids such as glutamine, proline, and arginine in animals and plants.

※ Please kindly note that our products are for research use only.