L-Peganine

Catalog Number	ACM6159564-1
CAS Number	6159-56-4
Structure
Synonyms	1,2,3,9-Tetrahydropyrrolo[2,1-b]quinazolin-3-ol
Molecular Weight	188.23
InChI	InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2
InChI Key	YIICVSCAKJMMDJ-UHFFFAOYSA-N
Melting Point	211 °C
Purity	95%+
Complexity	264
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	188.094963011
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	188.094963011
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	35.8 Ų

Custom Q&A

What is the chemical formula of Peganine?

The chemical formula of Peganine is C11H12N2O.

What is the molecular weight of Peganine?

The molecular weight of Peganine is 188.23.

What is the melting point of Peganine?

The melting point of Peganine is 211 °C.

What is the boiling point of Peganine?

The boiling point of Peganine is 373.8±52.0 °C (Predicted).

What is the density of Peganine?

The density of Peganine is 1.37±0.1 g/cm3 (Predicted).

How is Peganine classified for safety purposes?

Peganine is classified under HS Code 2939800000 for safety purposes.

What is the usage of Peganine?

Peganine can be used for the preparation of Vicinal Tricarbonyls and cyano analogs as electrophilic participants in forming pharmacophoric templates for drug discovery.

What alkaloid is Peganine isolated from?

Peganine is a quinazoline alkaloid isolated from nature.

What is the ChEBI definition of Peganine?

The ChEBI definition of Peganine is 1,2,3,9-Tetrahydropyrrolo[2,1-b]quinazolin-3-ol.

What is another name for Peganine?

Another name for Peganine is (±)-Vasicine.

※ Please kindly note that our products are for research use only.