Lauterine

Lauterine

Inquiry
Catalog Number ACM28200659
CAS Number 28200-65-9
Structure
Synonyms Oxolaureline
Molecular Weight 305.3
InChI InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)15-14-9(4-5-19-16(14)17(11)20)6-13-18(15)23-8-22-13/h2-7H,8H2,1H3
InChI Key BHFUORVSBHCRKK-UHFFFAOYSA-N
Purity 95%+
Complexity 497
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 305.06880783
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 305.06880783
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 57.6 Ų
Custom Q&A

What is the chemical name for Lauterine?

The chemical name for Lauterine is 11-methoxy-8H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one.

What are some synonyms for Lauterine?

Some synonyms for Lauterine are NSC 267718, Oxolaureline, and Oxolaurenine.

What is the CAS number for Lauterine?

The CAS number for Lauterine is 28200-65-9.

What is the molecular formula of Lauterine?

The molecular formula of Lauterine is C18H11NO4.

What is the molecular weight of Lauterine?

The molecular weight of Lauterine is 305.28 g/mol.

What is the structure of Lauterine?

The structure of Lauterine is 11-methoxy-8H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one.

Is Lauterine a commonly used chemical compound?

Lauterine is not a commonly used chemical compound.

What are some potential uses of Lauterine?

Lauterine may have potential uses in research and development, particularly in the field of pharmacology.

How can Lauterine be obtained?

Lauterine can be obtained through chemical synthesis or extraction from natural sources, depending on the required purity and quantity.

※ Please kindly note that our products are for research use only.