Leptomerine

Catalog Number	ACM22048971
CAS Number	22048-97-1
Molecular Weight	201.26
InChI	InChI=1S/C13H15NO/c1-3-6-10-9-13(15)11-7-4-5-8-12(11)14(10)2/h4-5,7-9H,3,6H2,1-2H3
InChI Key	HHCLDHNLTJDYEN-UHFFFAOYSA-N
Purity	95%+
Complexity	282
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	201.115364102
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	201.115364102
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical formula of ACACETIN-7-GLUCOSIDE?

The chemical formula of ACACETIN-7-GLUCOSIDE is C22H22O10.

What is the molecular weight of ACACETIN-7-GLUCOSIDE?

The molecular weight of ACACETIN-7-GLUCOSIDE is 446.4.

What is the melting point of ACACETIN-7-GLUCOSIDE?

The melting point of ACACETIN-7-GLUCOSIDE is 260-262℃.

In which solvents is ACACETIN-7-GLUCOSIDE soluble?

ACACETIN-7-GLUCOSIDE is soluble in DMSO.

What are the biological activities of Tilianin?

Tilianin has antihypertensive, myocardial protection, antidiabetic, hypolipidemic, anti-inflammatory, and antioxidant effects.

From which plant is ACACETIN-7-GLUCOSIDE derived?

ACACETIN-7-GLUCOSIDE is derived from Dracocephalum moldavica L.

What is the color of ACACETIN-7-GLUCOSIDE in its powder form?

ACACETIN-7-GLUCOSIDE is white-yellowish in color in its powder form.

What are the chemical properties of ACACETIN-7-GLUCOSIDE?

ACACETIN-7-GLUCOSIDE is soluble in organic solvents such as methanol, ethanol, and DMSO.

How does Tilianin affect the secretion of proinflammatory cytokines in vitro?

Tilianin reduces the secretion of LPS-induced proinflammatory cytokines in RAW264.7 macrophage cells.

What are the target receptors affected by Tilianin?

Tilianin targets 5-HT receptor, GABA receptor, ATPase, NO, NOS, Caspase, Bcl-2/Bax, Potassium Channel, and P-gp.

※ Please kindly note that our products are for research use only.