Lindelofine

Catalog Number	ACM487990
CAS Number	487-99-0
Synonyms	(2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester
Molecular Weight	285.38
InChI	InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12+,13-,15+/m1/s1
InChI Key	BWQSLRZZOVFVHJ-COMQUAJESA-N
Purity	95%+
Complexity	360
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	285.19400834
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]([C@@](C(C)C)(C(=O)OC[C@@H]1CCN2[C@@H]1CCC2)O)O
Monoisotopic Mass	285.19400834
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	70 Ų

Custom Q&A

What is the full chemical name of Lindelofine?

The full chemical name of Lindelofine is (2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester.

What are some synonyms for Lindelofine?

Some synonyms for Lindelofine are (2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester and Lindelofine.

What is the molecular formula of Lindelofine?

The molecular formula of Lindelofine is C15H27NO4.

What is the molar mass of Lindelofine?

The molar mass of Lindelofine is 285.38 g/mol.

What is the CAS number for Lindelofine?

The CAS number for Lindelofine is 487-99-0.

What is the stereochemistry of Lindelofine?

Lindelofine is (2S,3R)-configured compound.

What is the functional group present in Lindelofine?

The functional groups present in Lindelofine are hydroxyl, ester, and pyrrolizidine.

What is the significance of the isopropyl group in Lindelofine?

The isopropyl group in Lindelofine contributes to its structure and properties, such as its solubility and stability.

How is Lindelofine typically used in research or applications?

Lindelofine may be used as a reference compound in chemical analysis, or in biological studies to investigate its potential pharmacological properties.

※ Please kindly note that our products are for research use only.