Lindelofine

Lindelofine

Inquiry
Catalog Number ACM487990
CAS Number 487-99-0
Structure
Synonyms (2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester
Molecular Weight 285.38
InChI InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12+,13-,15+/m1/s1
InChI Key BWQSLRZZOVFVHJ-COMQUAJESA-N
Purity 95%+
Complexity 360
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 285.19400834
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 2
Isomeric SMILES C[C@H]([C@@](C(C)C)(C(=O)OC[C@@H]1CCN2[C@@H]1CCC2)O)O
Monoisotopic Mass 285.19400834
PhysicalState Powder
Rotatable Bond Count 6
Topological Polar Surface Area 70 Ų
Custom Q&A

What is the full chemical name of Lindelofine?

The full chemical name of Lindelofine is (2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester.

What are some synonyms for Lindelofine?

Some synonyms for Lindelofine are (2S,3R)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester and Lindelofine.

What is the molecular formula of Lindelofine?

The molecular formula of Lindelofine is C15H27NO4.

What is the molar mass of Lindelofine?

The molar mass of Lindelofine is 285.38 g/mol.

What is the CAS number for Lindelofine?

The CAS number for Lindelofine is 487-99-0.

What is the stereochemistry of Lindelofine?

Lindelofine is (2S,3R)-configured compound.

What is the functional group present in Lindelofine?

The functional groups present in Lindelofine are hydroxyl, ester, and pyrrolizidine.

What is the significance of the isopropyl group in Lindelofine?

The isopropyl group in Lindelofine contributes to its structure and properties, such as its solubility and stability.

How is Lindelofine typically used in research or applications?

Lindelofine may be used as a reference compound in chemical analysis, or in biological studies to investigate its potential pharmacological properties.

※ Please kindly note that our products are for research use only.