Linifanib

Catalog Number	ACM796967163
CAS Number	796967-16-3
Structure
IUPAC Name	1-[4-(3-Amino-1H-indazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea
Molecular Weight	375.41
Molecular Formula	C21H18FN5O
Canonical SMILES	CC1=CC(=C(C=C1)F)NC(=O)NC2=CC=C(C=C2)C3=C4C(=CC=C3)NN=C4N
InChI	InChI=1S/C21H18FN5O/c1-12-5-10-16(22)18(11-12)25-21(28)24-14-8-6-13(7-9-14)15-3-2-4-17-19(15)20(23)27-26-17/h2-11H,1H3,(H3,23,26,27)(H2,24,25,28)
InChI Key	MPVGZUGXCQEXTM-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	541
Exact Mass	375.14953838
Heavy Atom Count	28
Monoisotopic Mass	375.14953838
Topological Polar Surface Area	95.8Ų

Custom Q&A

What is another name for Linifanib (ABT-869)?

Linifanib; N-[4-(3-Amino-1H-indazol-4-yl)phenyl]-N'-(2-fluoro-5-methylphenyl)urea

What is the chemical formula of Linifanib?

C21H18FN5O

What is the molecular weight of Linifanib?

375.4

What is the melting point of Linifanib?

180-183°C (dec.)

What is the boiling point of Linifanib?

Predicted to be 542.2±50.0 °C

In which solvents is Linifanib soluble?

DMSO, Methanol

What is the primary use of Linifanib?

It is a novel, potent ATP-competitive RTK inhibitor for KDR, CSF-1R, Flt-1, Flt-3 and PDGFRβ

What is the storage temperature recommended for Linifanib?

-20°C Freezer

What is the biological activity of Linifanib?

It is an effective ATP-competitive tyrosine kinase inhibitor against the platelet-derived growth factor (PDGF) receptor and the vascular endothelial growth factor receptor (VEGFR) families.

What is the target of Linifanib?

VEGFR1/FLT1

※ Please kindly note that our products are for research use only.