Lobeline

Catalog Number	ACM90697-1
CAS Number	90-69-7
Synonyms	Lobelinum
IUPAC Name	2-[(2R,6S)-6-[(2S)-2-Hydroxy-2-phenylethyl]-1-methylpiperidin-2-yl]-1-phenylethanone
Molecular Weight	337.46
Molecular Formula	C22H27NO2
Canonical SMILES	CN1C(CCCC1CC(=O)C2=CC=CC=C2)CC(C3=CC=CC=C3)O
InChI	InChI=1S/C22H27NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-21,24H,8,13-16H2,1H3/t19-,20+,21-/m0/s1
InChI Key	MXYUKLILVYORSK-HBMCJLEFSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	412
Exact Mass	337.204179104
Heavy Atom Count	25
Isomeric SMILES	CN1[C@@H](CCC[C@@H]1CC(=O)C2=CC=CC=C2)C[C@@H](C3=CC=CC=C3)O
Monoisotopic Mass	337.204179104
Topological Polar Surface Area	40.5Ų

Custom Q&A

What is the chemical formula of Lobeline?

The chemical formula of Lobeline is C22H27NO2.

What is the melting point of Lobeline?

The melting point of Lobeline is 130-131°C.

What is the boiling point of Lobeline?

The boiling point of Lobeline is estimated to be 473.76°C.

How is Lobeline synthesized?

Lobeline is synthesized by condensation of 2,6-dimethylpyridine with two moles of benzaldehyde, leading to the formation of lobeline.

What are the main sources of Lobeline?

Lobeline is mainly present in Lobelia chinensis, Lobelia inflata, Campanula medium, Lobelia hassleri, and Lobelia nicotianaefolia.

What are some safety hazards associated with Lobeline?

Lobeline is considered hazardous, with risk statements 23/24/25 and safety statements 36/37/39-45.

How is Lobeline historically used in medicine?

Historically, Lobeline has been used for the treatment of respiratory diseases, asthma, and as a vomiting agent to remove toxins from the body.

How does Lobeline compare to nicotine in terms of potency?

Lobeline is much weaker than nicotine, with a potency of only 1/5~1/20 of nicotine.

What are some of the pharmacological effects of Lobeline?

Lobeline has nicotine-like effects, selectively exciting chemoreceptors, inducing respiratory center excitement, enhancing respiratory function, and regulating ganglion activity.

What are some side effects associated with Lobeline use?

Some side effects of Lobeline include nausea, vomiting, cough, headache, and palpitations.

※ Please kindly note that our products are for research use only.