Loroquine

Catalog Number	ACM27792821
CAS Number	27792-82-1
Structure
Synonyms	2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one
Molecular Weight	151.16
InChI	InChI=1S/C8H9NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,3,10H,2,4-5H2
InChI Key	ZGJHFPBCIVRXAQ-UHFFFAOYSA-N
Purity	95%+
Complexity	181
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	151.06332853
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	151.06332853
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	42.2 Ų

Custom Q&A

What is the chemical structure of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

The chemical structure of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one is C8H9NO2.

What are some synonyms for 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

Some synonyms for 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one include 6-Hydroxymethyl-1-azabicyclo[3.3.0]octane-5,7-dien-4-one and Loroquine.

What is the CAS number for 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

The CAS number for 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one is 27792-82-1.

What is the molecular formula of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

The molecular formula of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one is C8H9NO2.

What is the molecular weight of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

The molecular weight of 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one is 151.16.

Where can 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one be found?

2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one can be found in the EtOH extract of Urechites karwinskii roots.

What happens when NaBH4 reacts with 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

NaBH4 reduces the ketone group to a secondary hydroxyl in 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one.

What effect does MnO2 have on 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one?

MnO2 oxidizes the hydroxymethyl group to the aldehyde in 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one.

Who conducted a study on 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one and published their findings in Tetrahedron Letters?

Del Castillo et al. conducted a study on 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one and published their findings in Tetrahedron Lett., 1219 (1970).

What is the significance of the compound Loroquine in the study?

Loroquine is the 2,3-Dihydro-7-(hydroxymethyl)-1H-pyrrolizin-1-one compound found in the EtOH extract of Urechites karwinskii roots, as mentioned in the study by Del Castillo et al.

※ Please kindly note that our products are for research use only.