Lumacaftor

Catalog Number	ACM936727058
CAS Number	936727-05-8
IUPAC Name	3-[6-[[1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methylpyridin-2-yl]benzoic acid
Molecular Weight	452.41
Molecular Formula	C24H18F2N2O5
Canonical SMILES	CC1=C(N=C(C=C1)NC(=O)C2(CC2)C3=CC4=C(C=C3)OC(O4)(F)F)C5=CC(=CC=C5)C(=O)O
InChI	InChI=1S/C24H18F2N2O5/c1-13-5-8-19(27-20(13)14-3-2-4-15(11-14)21(29)30)28-22(31)23(9-10-23)16-6-7-17-18(12-16)33-24(25,26)32-17/h2-8,11-12H,9-10H2,1H3,(H,29,30)(H,27,28,31)
InChI Key	UFSKUSARDNFIRC-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	776
Exact Mass	452.11837800
Heavy Atom Count	33
Monoisotopic Mass	452.11837800
Topological Polar Surface Area	97.8Ų

Custom Q&A

What is the chemical formula of Lumacaftor (VX-809)?

The chemical formula of Lumacaftor (VX-809) is C24H18F2N2O5.

What is the molecular weight of Lumacaftor (VX-809)?

The molecular weight of Lumacaftor (VX-809) is 452.41 g/mol.

What is the melting point of Lumacaftor (VX-809)?

The melting point of Lumacaftor (VX-809) is 200-205°C.

What is the usage of Lumacaftor (VX-809)?

Lumacaftor (VX-809) is used in the stabilization of the CFTR protein for the treatment of cystic fibrosis.

What is the biological activity of Lumacaftor (VX-809)?

Lumacaftor (VX-809) is a CFTR corrector that partially restores the function of f508del-CFTR.

What type of cells does Lumacaftor (VX-809) affect?

Lumacaftor (VX-809) affects fischer rat thyroid (FRT) cells.

How does Lumacaftor (VX-809) stabilize the N-terminal fragment of CFTR?

Lumacaftor (VX-809) stabilizes the N-terminal fragment of CFTR by altering its protein conformation.

What is the storage temperature recommended for Lumacaftor (VX-809)?

The recommended storage temperature for Lumacaftor (VX-809) is -20°C in a freezer.

What is the solubility of Lumacaftor (VX-809)?

Lumacaftor (VX-809) is slightly soluble in DMSO and methanol.

What is the boiling point of Lumacaftor (VX-809)?

The predicted boiling point of Lumacaftor (VX-809) is 653.0±55.0 °C.

※ Please kindly note that our products are for research use only.