Methyl 9H-pyrido[3,4-b]indole-1-carboxylate

Catalog Number	ACM3464662-1
CAS Number	3464-66-2
Structure
Synonyms	1-Methoxycarbonyl-beta-carboline
Molecular Weight	226.23
InChI	InChI=1S/C13H10N2O2/c1-17-13(16)12-11-9(6-7-14-12)8-4-2-3-5-10(8)15-11/h2-7,15H,1H3
InChI Key	FRNCTTUBAHKEBZ-UHFFFAOYSA-N
Purity	95%+
Complexity	308
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	226.074227566
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	226.074227566
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	55 Ų

Custom Q&A

What is the chemical name of the compound referred to as Methyl β-carboline-1-carboxylate?

The chemical name is Methyl 9H-pyrido[3,4-b]indole-1-carboxylate.

What are some synonyms of Methyl β-carboline-1-carboxylate?

Some synonyms include 9H-Pyrido[3,4-b]indole-1-carboxylic acid methyl ester and 1-Methoxycarbonyl-beta-carboline.

What is the CAS number for Methyl β-carboline-1-carboxylate?

The CAS number is 3464-66-2.

What is the molecular formula of Methyl β-carboline-1-carboxylate?

The molecular formula is C13H10N2O2.

What is the molecular weight of Methyl β-carboline-1-carboxylate?

The molecular weight is 226.23.

What is the melting point of Methyl β-carboline-1-carboxylate?

The melting point is 165.3-166 °C.

What is the predicted boiling point of Methyl β-carboline-1-carboxylate?

The predicted boiling point is 466.7±25.0 °C.

What is the predicted density of Methyl β-carboline-1-carboxylate?

The predicted density is 1.353±0.06 g/cm3.

What is the recommended storage temperature for Methyl β-carboline-1-carboxylate?

The recommended storage temperature is 2-8°C.

What is the predicted pKa value of Methyl β-carboline-1-carboxylate?

The predicted pKa value is 14.17±0.40.

※ Please kindly note that our products are for research use only.