Milrinone

Catalog Number	ACM78415722-1
CAS Number	78415-72-2
Structure
Synonyms	Primacor
IUPAC Name	6-Methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile
Molecular Weight	211.22
Molecular Formula	C12H9N3O
Canonical SMILES	CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2
InChI	InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16)
InChI Key	PZRHRDRVRGEVNW-UHFFFAOYSA-N
Purity	98%+(HPLC)
Appearance	White crystals
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	419
Exact Mass	211.074561919
Heavy Atom Count	16
Monoisotopic Mass	211.074561919
Topological Polar Surface Area	65.8Ų

Custom Q&A

What are some synonyms for Milrinone?

Corotrope, Milrila, Primacor, YM-018

What is the chemical formula of Milrinone?

C12H9N3O

What is the melting point and boiling point of Milrinone?

Melting point >300°C, Boiling point 350.9°C

How is Milrinone primarily metabolized in the body?

It is mainly metabolically inactivated in the liver, with 80% of it excreted unchanged in the urine.

What is the mechanism of action of Milrinone?

Milrinone is a phosphodiesterase inhibitor that increases intracellular cyclic adenosine monophosphate, leading to increased myocardial contractility and peripheral vasodilation.

What is the dosage recommendation for Milrinone?

The first dose is a slow intravenous injection, followed by a continuous intravenous drip of 0.375-0.750 μg/(kg · min). The maximum daily dose is 1.13 mg/kg.

How does Milrinone interact with angiotensin-converting enzyme inhibitors?

It can further improve hemodynamics but may also increase side effects related to blood vessel dilation.

What are some precautions to consider when using Milrinone?

Patients with ventricular arrhythmias, hypotension, tachycardia, renal insufficiency, and other conditions should use it with caution.

What are some chemical properties of Milrinone?

It has an off-white color, is soluble in DMSO, and is stable but incompatible with strong oxidizing agents.

What is the main use of Milrinone in clinical practice?

Milrinone is used in the treatment of acute and chronic heart failure, including cases where digitalis and diuretics are ineffective.

※ Please kindly note that our products are for research use only.