Murrastinine C

Catalog Number	ACM20105208
CAS Number	20105-20-8
IUPAC Name	3,3-Dimethyl-11H-pyrano[3,2-a]carbazole-8-carbaldehyde
Molecular Weight	277.3
Molecular Formula	C18H15NO2
Canonical SMILES	CC1(C=CC2=C(O1)C=CC3=C2NC4=C3C=C(C=C4)C=O)C
InChI	InChI=1S/C18H15NO2/c1-18(2)8-7-13-16(21-18)6-4-12-14-9-11(10-20)3-5-15(14)19-17(12)13/h3-10,19H,1-2H3
InChI Key	QTXCJUWYNICVSM-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	458
Exact Mass	277.110278721
Heavy Atom Count	21
Monoisotopic Mass	277.110278721
Topological Polar Surface Area	42.1Ų

Custom Q&A

What is the chemical formula of Murrastinine C?

The chemical formula of Murrastinine C is C18H15NO2.

What is the molecular weight of Murrastinine C?

The molecular weight of Murrastinine C is 277.32.

What is the CAS number of Murrastinine C?

The CAS number of Murrastinine C is 20105-20-8.

What are some synonyms of Murrastinine C?

Some synonyms of Murrastinine C are Pyrano[3,2-a]carbazole-8-carboxaldehyde and 3,11-dihydro-3,3-dimethyl.

What is the predicted boiling point of Murrastinine C?

The predicted boiling point of Murrastinine C is 505.7±50.0 °C.

What is the predicted density of Murrastinine C?

The predicted density of Murrastinine C is 1.276±0.06 g/cm3.

What is the predicted pKa value of Murrastinine C?

The predicted pKa value of Murrastinine C is 16.07±0.40.

What is the predicted boiling point range of Murrastinine C?

The predicted boiling point range of Murrastinine C is 505.7±50.0 °C.

What is the predicted density range of Murrastinine C?

The predicted density range of Murrastinine C is 1.276±0.06 g/cm3.

What is the predicted pKa value range of Murrastinine C?

The predicted pKa value range of Murrastinine C is 16.07±0.40.

※ Please kindly note that our products are for research use only.