Murrayamine E

Catalog Number	ACM172617684
CAS Number	172617-68-4
Molecular Weight	347.4
InChI	InChI=1S/C23H25NO2/c1-12-9-15-14-6-5-13(25)10-18(14)24-20(15)19-16-11-23(4,26-21(12)19)8-7-17(16)22(24,2)3/h5-6,9-10,16-17,25H,7-8,11H2,1-4H3/t16-,17+,23-/m1/s1
InChI Key	YDUWCKHQORLZSO-SAHWJRBASA-N
Purity	95%+
Complexity	619
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	347.18852904
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC1=CC2=C3C4=C1O[C@@]5(CC[C@@H]([C@H]4C5)C(N3C6=C2C=CC(=C6)O)(C)C)C
Monoisotopic Mass	347.18852904
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	34.4 Ų

Custom Q&A

What is the chemical formula of Murrayamine E?

The chemical formula of Murrayamine E is C23H25NO2.

What is the molecular weight of Murrayamine E?

The molecular weight of Murrayamine E is 347.46 g/mol.

What is the CAS number of Murrayamine E?

The CAS number of Murrayamine E is 172617-68-4.

What are the synonyms of Murrayamine E?

The synonyms of Murrayamine E are 1,12-Epoxy-9H-indolo[3,2,1-de]phenanthridin-6-ol, 9a,10,11,12,13,13a-hexahydro-2,9,9,12-tetramethyl-, (9aR,12S,13aR)-rel-(+)- (9CI).

What is the predicted boiling point of Murrayamine E?

The predicted boiling point of Murrayamine E is 523.3±42.0 °C.

What is the predicted density of Murrayamine E?

The predicted density of Murrayamine E is 1.37±0.1 g/cm3.

What is the predicted pka value of Murrayamine E?

The predicted pka value of Murrayamine E is 10.31±0.60.

What is the Reaxys ID of Murrayamine E?

The Reaxys ID of Murrayamine E is 26195417.

What is the stereochemistry of Murrayamine E?

The stereochemistry of Murrayamine E is (9aR,12S,13aR)-rel-(+)- (9CI).

※ Please kindly note that our products are for research use only.