Musk ketone

Catalog Number	ACM81141-1
CAS Number	81-14-1
Synonyms	Ketone moschus
IUPAC Name	1-(4-Tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone
Molecular Weight	294.30
Molecular Formula	C14H18N2O5
Canonical SMILES	CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-])C)C(=O)C
InChI	InChI=1S/C14H18N2O5/c1-7-10(9(3)17)8(2)13(16(20)21)11(14(4,5)6)12(7)15(18)19/h1-6H3
InChI Key	WXCMHFPAUCOJIG-UHFFFAOYSA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	418
Exact Mass	294.12157168
Heavy Atom Count	21
Monoisotopic Mass	294.12157168
Topological Polar Surface Area	109Ų

Custom Q&A

What is the chemical formula of Musk ketone?

The chemical formula of Musk ketone is C14H18N2O5.

What is the melting point of Musk ketone?

The melting point of Musk ketone is 134-137 °C.

What is the boiling point of Musk ketone?

The boiling point of Musk ketone is approximately 436.08°C.

What is the odor type of Musk ketone?

The odor type of Musk ketone is musk.

What is the water solubility of Musk ketone?

Musk ketone is insoluble in water (<0.1 g/100 mL at 20 ºC).

What is the stability of Musk ketone?

Musk ketone is stable. It is incompatible with strong oxidizing agents, strong acids, and strong bases.

How is Musk ketone prepared?

Musk ketone is prepared by Friedel-Crafts acetylation of 1,3-dimethyl-5-tert-butylbenzene and nitration of the resulting 2,6-dimethyl-4-tert-butylacetophenone with nitric acid.

What is the usage of Musk ketone?

Musk ketone is widely used as a fixative in blossom and fantasy compositions.

What is the color of Musk ketone?

Musk ketone is described as a white to light yellow crystal powder.

How can Musk ketone be purified?

Musk ketone can be purified by recrystallization from MeOH.

※ Please kindly note that our products are for research use only.