N-(4-Benzamidobutyl)benzamide

Catalog Number	ACM31991783
CAS Number	31991-78-3
Structure
Synonyms	Haplamide
Molecular Weight	296.4
InChI	InChI=1S/C18H20N2O2/c21-17(15-9-3-1-4-10-15)19-13-7-8-14-20-18(22)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,19,21)(H,20,22)
InChI Key	QSFWQDFBUPYPIH-UHFFFAOYSA-N
Purity	95%+
Complexity	311
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	296.152477885
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	296.152477885
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	58.2 Ų

Custom Q&A

What is the chemical name of the compound with CAS number 31991-78-3?

The chemical name is N-(4-benzamidobutyl)benzamide.

What are some synonyms for N-(4-benzamidobutyl)benzamide?

Some synonyms include N,N'-1,4-butanediylbis-benzamide, Haplamide, and N,N'-(Butane-1,4-diyl)dibenzamide.

What is the molecular formula of N-(4-benzamidobutyl)benzamide?

The molecular formula is C18H20N2O2.

What is the molecular weight of N-(4-benzamidobutyl)benzamide?

The molecular weight is 296.36 g/mol.

What is the CAS number for N-(4-benzamidobutyl)benzamide?

The CAS number is 31991-78-3.

How many carbon atoms are in the chemical structure of N-(4-benzamidobutyl)benzamide?

There are a total of 18 carbon atoms.

What is the function of benzamide in N-(4-benzamidobutyl)benzamide?

The benzamide group is used as a linker between the two benzene rings in the molecule.

What is the role of the butyl group in N-(4-benzamidobutyl)benzamide?

The butyl group serves as a spacer between the benzamide and benzene groups.

Can N-(4-benzamidobutyl)benzamide be used in pharmaceutical applications?

It is possible, as benzamides are known to have various pharmaceutical activities.

How does the structure of N-(4-benzamidobutyl)benzamide contribute to its potential biological activity?

The presence of the benzamide and butyl groups in the molecule may play a role in its interactions with biological targets.

※ Please kindly note that our products are for research use only.