N-Methylhomoveratrylamine

Catalog Number	ACM3490060
CAS Number	3490-06-0
Structure
Synonyms	2-(3,4-Dimethoxyphenyl)-N-methylethylamine
Molecular Weight	195.26
InChI	InChI=1S/C11H17NO2/c1-12-7-6-9-4-5-10(13-2)11(8-9)14-3/h4-5,8,12H,6-7H2,1-3H3
InChI Key	HNJWKRMESUMDQE-UHFFFAOYSA-N
Melting Point	160-161 °C
Purity	98%+
Complexity	152
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	195.125928785
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	195.125928785
PhysicalState	Solid
Rotatable Bond Count	5
Topological Polar Surface Area	30.5 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 3490-06-0?

The product name is N-Methylhomoveratrylamine.

What are some synonyms for N-Methylhomoveratrylamine?

Some synonyms include AURORA KA-7753, AKOS BBS-00006509, and 3,4-DIMETHOXY-N-METHYLPHENETHYLAMINE.

What is the molecular formula of N-Methylhomoveratrylamine?

The molecular formula is C11H17NO2.

What is the molecular weight of N-Methylhomoveratrylamine?

The molecular weight is 195.26 g/mol.

What is the boiling point of N-Methylhomoveratrylamine?

The boiling point is 160-161 °C at 13 mm Hg.

What is the density of N-Methylhomoveratrylamine at 25 °C?

The density is 1.059 g/mL at 25 °C.

What are the safety hazard codes associated with N-Methylhomoveratrylamine?

The hazard codes are Xi, with risk statements 36/37/38 and safety statements 26-37/39.

What is the chemical property of N-Methylhomoveratrylamine?

It is a light yellow liquid.

How can N-Methylhomoveratrylamine be used?

It is a fundamental synthetic intermediate and can be used for the preparation of various biologically active compounds.

What is the solubility of N-Methylhomoveratrylamine?

It is soluble in chloroform and methanol.

※ Please kindly note that our products are for research use only.