N-Methyllindcarpine

Catalog Number	ACM14028978
CAS Number	14028-97-8
Molecular Weight	327.4
InChI	InChI=1S/C19H21NO4/c1-20-7-6-11-9-13(21)19(24-3)17-15(11)12(20)8-10-4-5-14(23-2)18(22)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1
InChI Key	MBKKEBKZSKSAPX-LBPRGKRZSA-N
Purity	95%+
Complexity	461
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	327.14705815
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)O
Monoisotopic Mass	327.14705815
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	62.2 Ų

Custom Q&A

What is the chemical name of the compound with the synonym N-Methyllindcarpine?

The chemical name is 2,11-Dihydroxy-1,10-dimethoxyaporphine.

What is the CAS number of N-Methyllindcarpine?

The CAS number is 14028-97-8.

What is the molecular formula of N-Methyllindcarpine?

The molecular formula is C19H21NO4.

What is the molecular weight of N-Methyllindcarpine?

The molecular weight is 327.37.

What is the melting point of N-Methyllindcarpine?

The melting point is 196 °C (decomposition).

What is the predicted boiling point of N-Methyllindcarpine?

The predicted boiling point is 529.3±50.0 °C.

What is the predicted density of N-Methyllindcarpine?

The predicted density is 1.290±0.06 g/cm3.

What is the predicted pKa of N-Methyllindcarpine?

The predicted pKa is 9.46±0.20.

What is the structure of N-Methyllindcarpine based on its chemical properties?

The compound is a 4H-Dibenzo[de,g]quinoline-2,11-diol, 5,6,6a,7-tetrahydro-1,10-dimethoxy-6-methyl-, with stereochemistry (6aS)-.

What are some basic information provided for N-Methyllindcarpine in the reference?

The product name, synonyms, CAS number, molecular formula, molecular weight, melting point, boiling point, density, pKa, and molecular structure are provided.

※ Please kindly note that our products are for research use only.