N-Methylsarpagine methosalt

Catalog Number	ACM47418702
CAS Number	47418-70-2
Synonyms	10,17-Dihydroxy-1,4-dimethylsarpaganium
Molecular Weight	339.5
InChI	InChI=1S/C21H26N2O2/c1-4-12-10-23(3)19-9-16-15-7-13(25)5-6-18(15)22(2)21(16)20(23)8-14(12)17(19)11-24/h4-7,14,17,19-20,24H,8-11H2,1-3H3/p+1/b12-4-/t14-,17+,19-,20-,23/m0/s1
InChI Key	JTTRGCDSKZRQPP-PRQFWUQUSA-O
Purity	95%+
Complexity	592
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	339.207253108
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/C[N+]2([C@H]3C[C@@H]1[C@H]([C@@H]2CC4=C3N(C5=C4C=C(C=C5)O)C)CO)C
Monoisotopic Mass	339.207253108
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	45.4 Ų

Custom Q&A

What is the chemical formula for N-Methylsarpagine methosalt?

The chemical formula for N-Methylsarpagine methosalt is C21H27N2O2+.

What is the molecular weight of N-Methylsarpagine methosalt?

The molecular weight of N-Methylsarpagine methosalt is 339.46.

What is the CAS number for N-Methylsarpagine methosalt?

The CAS number for N-Methylsarpagine methosalt is 47418-70-2.

In what forms is N-Methylsarpagine methosalt soluble?

N-Methylsarpagine methosalt is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What are some synonyms for N-Methylsarpagine methosalt?

Some synonyms for N-Methylsarpagine methosalt are 10,17-Dihydroxy-1,4-dimethylsarpaganium and 1-Methylspegatrine.

What is the physical form of N-Methylsarpagine methosalt?

N-Methylsarpagine methosalt is in powder form.

How does the solubility of N-Methylsarpagine methosalt in different solvents affect its potential applications?

The solubility of N-Methylsarpagine methosalt in various solvents can impact its potential applications in different fields such as pharmaceuticals or research.

※ Please kindly note that our products are for research use only.