N-Nornuciferine

Catalog Number	ACM4846199
CAS Number	4846-19-9
Synonyms	Daechualkaloid E
IUPAC Name	(6aR)-1,2-Dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline
Molecular Weight	281.35
Molecular Formula	C18H19NO2
Canonical SMILES	COC1=C(C2=C3C(CC4=CC=CC=C42)NCCC3=C1)OC
InChI	InChI=1S/C18H19NO2/c1-20-15-10-12-7-8-19-14-9-11-5-3-4-6-13(11)17(16(12)14)18(15)21-2/h3-6,10,14,19H,7-9H2,1-2H3/t14-/m1/s1
InChI Key	QQKAHDMMPBQDAC-CQSZACIVSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	374
Exact Mass	281.141578849
Heavy Atom Count	21
Isomeric SMILES	COC1=C(C2=C3[C@@H](CC4=CC=CC=C42)NCCC3=C1)OC
Monoisotopic Mass	281.141578849
Topological Polar Surface Area	30.5Ų

Custom Q&A

What is the chemical formula of (R)-Nornuciferine?

The chemical formula of (R)-Nornuciferine is C18H19NO2.

What is the molecular weight of (R)-Nornuciferine?

The molecular weight of (R)-Nornuciferine is 281.35 g/mol.

What is the melting point of (R)-Nornuciferine?

The melting point of (R)-Nornuciferine is 128-129℃.

What is the boiling point of (R)-Nornuciferine?

The boiling point of (R)-Nornuciferine is 446.4±45.0 °C (Predicted).

In what form does (R)-Nornuciferine exist?

(R)-Nornuciferine exists in solid form.

What is the solubility of (R)-Nornuciferine in DMSO?

(R)-Nornuciferine is soluble in DMSO.

What is the storage temperature recommended for (R)-Nornuciferine?

The recommended storage temperature for (R)-Nornuciferine is 2-8°C (protect from light).

What is the pKa value of (R)-Nornuciferine?

The pKa value of (R)-Nornuciferine is 8.29±0.20 (Predicted).

Where is N-Nornuciferine extracted from?

N-Nornuciferine is an alkaloid extracted from the Hottuynia cordata.

What activity does N-Nornuciferine display?

N-Nornuciferine displays anti-inflammatory activity.

※ Please kindly note that our products are for research use only.