N-Oxysophoridine

Catalog Number	ACM54809744
CAS Number	54809-74-4
Synonyms	Sophoridine N-oxide
Molecular Weight	264.36
InChI	InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17/m0/s1
InChI Key	XVPBINOPNYFXID-LHDUFFHYSA-N
Melting Point	162-164 °C
Purity	95%+
Complexity	400
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	264.183778013
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C[C@@H]2[C@H]3CCC[N+]4([C@H]3[C@@H](CCC4)CN2C(=O)C1)[O-]
Monoisotopic Mass	264.183778013
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	38.4 Ų

Custom Q&A

What is the chemical name of oxysophoridine?

The chemical name of oxysophoridine is Sophoridine N-oxide.

What is the CAS number for oxysophoridine?

The CAS number for oxysophoridine is 54809-74-4.

What is the molecular formula of oxysophoridine?

The molecular formula of oxysophoridine is C15H24N2O2.

What is the molecular weight of oxysophoridine?

The molecular weight of oxysophoridine is 264.36 g/mol.

What is the melting point of oxysophoridine?

The melting point of oxysophoridine is 162-4°C.

How should oxysophoridine be stored?

Oxysophoridine should be stored at 2-8°C.

What is the solubility of oxysophoridine in DMSO?

The solubility of oxysophoridine in DMSO is 25 mg/mL (94.57 mM) with ultrasonic and warming.

What is the predicted pKa of oxysophoridine?

The predicted pKa of oxysophoridine is 4.87±0.20.

How is oxysophoridine obtained and characterized?

Oxysophoridine is obtained from Sophora alopecuroides L and characterized by colorless needles from Me2CO.

What is the specific rotation of oxysophoridine?

The specific rotation of oxysophoridine is [α]D-50.6° (c 0.555, EtOH).

※ Please kindly note that our products are for research use only.