Narciclasine

Catalog Number	ACM29477836
CAS Number	29477-83-6
Structure
Description	Isocarbostyril alkaloid found in the Amaryllidaceae family of flower
Synonyms	(2S,3R,4S,4aR)-2,3,4,7-Tetrahydroxy-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one
Molecular Weight	307.26 g/mol
Molecular Formula	C14H13NO7
Canonical SMILES	C1OC2=C(O1)C(=C3C(=C2)C4=C[C@@H]([C@H]([C@H]([C@@H]4NC3=O)O)O)O)O
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939490000 - China: 2939799091
MDL Number	MFCD01729949

Custom Q&A

What is the chemical formula for narciclasine?

The chemical formula for narciclasine is C14H13NO7.

What is the molecular weight of narciclasine?

The molecular weight of narciclasine is 307.26 g/mol.

What is the melting point of narciclasine?

The melting point of narciclasine is 250-252°C.

What is the boiling point of narciclasine?

The boiling point of narciclasine is approximately 447.77°C.

What is the solubility of narciclasine in DMSO?

Narciclasine is soluble in DMSO at a concentration of ≥10mg/mL.

How is narciclasine stored?

Narciclasine should be stored at -20°C.

What are the hazard codes associated with narciclasine?

The hazard code for narciclasine is Xn.

What is the main usage of narciclasine?

Narciclasine is used as an antiproliferative and pro-apoptotic inducer.

What signaling pathway does narciclasine regulate?

Narciclasine regulates the Rho/Rho kinase/LIM kinase/cofilin signaling pathway.

What is the source of narciclasine in nature?

Narciclasine can be found in the bulbs of several Narcissus species.

※ Please kindly note that our products are for research use only.