Nervosine

Catalog Number	ACM23179262
CAS Number	23179-26-2
Structure
Synonyms	Benzoic acid, 4-[(2-O-L-arabinofuranosyl-β-D-glucopyranosyl)oxy]-3,5-bis(3-methyl-2-buten-1-yl)-, [(1R,7aR)-hexahydro-1H-pyrrolizin-1-yl]methyl ester
Molecular Weight	691.8
InChI	InChI=1S/C36H53NO12/c1-19(2)7-9-21-14-24(34(44)45-18-23-11-13-37-12-5-6-25(23)37)15-22(10-8-20(3)4)32(21)48-36-33(30(42)28(40)26(16-38)47-36)49-35-31(43)29(41)27(17-39)46-35/h7-8,14-15,23,25-31,33,35-36,38-43H,5-6,9-13,16-18H2,1-4H3/t23,25-,26-,27+,28-,29+,30+,31-,33-,35,36-/m1/s1
InChI Key	LLZLNFVFAZZRDM-NYGIAEFMSA-N
Melting Point	102-107 °C
Purity	95%+
Complexity	1110
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	9
Exact Mass	691.35677613
Heavy Atom Count	49
Hydrogen Bond Acceptor Count	13
Hydrogen Bond Donor Count	6
Isomeric SMILES	CC(=CCC1=CC(=CC(=C1O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)OC3[C@@H]([C@H]([C@@H](O3)CO)O)O)CC=C(C)C)C(=O)OCC4CCN5[C@@H]4CCC5)C
Monoisotopic Mass	691.35677613
PhysicalState	Powder
Rotatable Bond Count	14
Topological Polar Surface Area	188 Ų

Custom Q&A

What is the molecular formula of Nervosine?

The molecular formula of Nervosine is C36H53NO12.

What is the melting point of Nervosine?

The melting point of Nervosine is 102-107 °C.

How is Nervosine obtained?

Nervosine is a gluco-pyrrolizidine alkaloid obtained from Liparis nervosa.

What is the predicted boiling point of Nervosine?

The predicted boiling point of Nervosine is 868.2±65.0 °C.

What is the density of Nervosine?

The density of Nervosine is 1.35±0.1 g/cm3.

What is the pka value of Nervosine?

The pka value of Nervosine is 12.77±0.70.

How is Nervosine characterized?

Nervosine is characterized as the crystalline picrate monohydrate with a melting point of 130-1°C.

What are some of the properties of the ultraviolet spectrum of Nervosine?

The ultraviolet spectrum of Nervosine exhibits absorption maxima at 243, 280, and 289 mJ1.

What is the molecular weight of Nervosine?

The molecular weight of Nervosine is 691.82.

What are some synonyms for Nervosine?

Some synonyms for Nervosine include the long chemical name provided and simply Nervosine.

※ Please kindly note that our products are for research use only.