Niclosamide

Niclosamide

Inquiry
Catalog Number ACM50657
CAS Number 50-65-7
Synonyms Niclocide
IUPAC Name 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide
Molecular Weight 327.12
Molecular Formula C13H8Cl2N2O4
Canonical SMILES C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O
InChI InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19)
InChI Key RJMUSRYZPJIFPJ-UHFFFAOYSA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 404
Exact Mass 325.9861121
Heavy Atom Count 21
Monoisotopic Mass 325.9861121
Topological Polar Surface Area 95.2Ų
Custom Q&A

What is the chemical formula of Niclosamide?

Niclosamide has the chemical formula C13H8Cl2N2O4.

What is the pharmacological mechanism of action of Niclosamide?

Niclosamide interferes with the energy metabolism of helminths, possibly by inhibiting adenosine triphosphate (ATP) production and inhibiting glucose uptake by parasites.

What are the indications for using Niclosamide?

Niclosamide is used to treat infections caused by T. saginata, D. latum, and H. nana. It is also effective against T. solium, but praziquantel is preferred due to the risk of cysticercosis.

What are the common side effects of Niclosamide?

Minor gastrointestinal complaints such as nausea, vomiting, abdominal pain, diarrhea, light-headedness, and pruritus are rarely seen as side effects of Niclosamide.

How should Niclosamide be stored?

Niclosamide should be stored in a ventilated, low-temperature, dry storeroom, separately from food raw materials.

What is the acute toxicity of Niclosamide in rats and mice?

The oral-rat LD50 of Niclosamide is 2500 mg/kg, and the oral-mouse LD50 is 1000 mg/kg.

What is the therapeutic function of Niclosamide?

Niclosamide is an anthelmintic drug used to treat tapeworm infections caused by various species.

How does Niclosamide affect the mTORC1 signaling pathway?

Niclosamide inhibits mTORC1 signaling and stimulates autophagy.

How does Niclosamide inhibit the Stat3 signaling pathway?

Niclosamide inhibits the activation and nuclear translocation of STAT3 selectively over STAT1 and STAT5, inhibiting transcription of STAT3 target genes.

How is Niclosamide used in the treatment of tapeworm infections?

Niclosamide is absorbed by intestinal cestodes but not nematodes. A single dose is usually sufficient for a cure rate of 95%. For certain tapeworms, a longer treatment course may be necessary.

※ Please kindly note that our products are for research use only.