Nilgirine

Catalog Number	ACM21009052
CAS Number	21009-05-2
Synonyms	(15E)-12β-Hydroxy-18-norsenecionan-11,16-dione
Molecular Weight	321.4
InChI	InChI=1S/C17H23NO5/c1-3-11-8-10(2)15(19)17(21)22-9-12-4-6-18-7-5-13(14(12)18)23-16(11)20/h3,10,13,15,19H,4-9H2,1-2H3/b11-3+/t10-,13-,15+/m1/s1
InChI Key	CRDPLWCMWMJVFE-BZOJOEQASA-N
Melting Point	127-128 °C
Purity	95%+
Complexity	580
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	321.15762283
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\C[C@H]([C@@H](C(=O)OCC2=C3[C@@H](CCN3CC2)OC1=O)O)C
Monoisotopic Mass	321.15762283
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of the compound known as Nilgirine?

The chemical name of the compound known as Nilgirine is (15E)-12β-Hydroxy-18-norsenecionan-11,16-dione.

What is another name for Nilgirine?

Another name for Nilgirine is [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione.

What is the CAS number for Nilgirine?

The CAS number for Nilgirine is 21009-05-2.

What is the molecular formula of Nilgirine?

The molecular formula of Nilgirine is C17H23NO5.

What is the molecular weight of Nilgirine?

The molecular weight of Nilgirine is 321.37.

What is the melting point of Nilgirine?

The melting point of Nilgirine is 127-8°C.

Where is Nilgirine obtained from?

Nilgirine is obtained from the seeds of Crotalaria mucronata Desv. indigenous to Nilgiris in Southern India.

What is the optical rotation of Nilgirine in ethanol?

The optical rotation of Nilgirine in ethanol is [α]20D + 31.5°.

How was the structure of Nilgirine elucidated?

The structure of Nilgirine was elucidated based on the alkaline hydrolysis products and the NMR and mass spectra.

What alkaloid is found in the same species grown in regions other than Nilgiris in Southern India?

The alkaloid found in the same species grown in other regions is Usaramine.

※ Please kindly note that our products are for research use only.