Odorine

Catalog Number	ACM72755205
CAS Number	72755-20-5
Synonyms	(S)-2-Methyl-N-[(2R)-1-[(E)-1-oxo-3-phenyl-2-propenyl]pyrrolidin-2-yl]butanamide
Molecular Weight	300.4
InChI	InChI=1S/C18H24N2O2/c1-3-14(2)18(22)19-16-10-7-13-20(16)17(21)12-11-15-8-5-4-6-9-15/h4-6,8-9,11-12,14,16H,3,7,10,13H2,1-2H3,(H,19,22)/b12-11+/t14-,16+/m0/s1
InChI Key	KZAOEMMZRGEBST-IXVOVUJJSA-N
Purity	90%+
Complexity	413
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	300.183778013
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@H](C)C(=O)N[C@H]1CCCN1C(=O)/C=C/C2=CC=CC=C2
Monoisotopic Mass	300.183778013
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	49.4 Ų

Custom Q&A

What is the chemical formula for ODORINE?

The chemical formula for ODORINE is C18H24N2O2.

What is the molecular weight of ODORINE?

The molecular weight of ODORINE is 300.4.

In what forms is ODORINE soluble?

ODORINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the occurrence of ODORINE in Aglaia odorata?

ODORINE is a constituent of the basic extract of Aglaia odorata, forming colorless needles when crystallized from C6H6H6.

What is the specific rotation of ODORINE in CHCl3?

The specific rotation of ODORINE in CHCl3 is [α]D25 +72.6° (c 0.03, CHCl3).

What is the ultraviolet spectrum of ODORINE in EtOH?

ODORINE gives an ultraviolet spectrum in EtOH consisting of a single absorption maximum at 283 nm.

What is another source of ODORINE aside from Aglaia odorata?

ODORINE has been isolated from Roxburghia species, forming colorless crystals from EtOH.

What is the specific rotation of ODORINE in CHCl3 (CHCl3)?

ODORINE has a specific rotation of [α]D +34° (CHCl3).

What is the primary use of ODORINE?

ODORINE is a chemopreventative agent and inhibitor of carcinogenesis.

What is the physical form of ODORINE?

ODORINE is in the form of a powder.

※ Please kindly note that our products are for research use only.