Oxocrebanine

Oxocrebanine

Inquiry
Catalog Number ACM38826425
CAS Number 38826-42-5
Synonyms 9,10-Dimethoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one
Molecular Weight 335.3
InChI InChI=1S/C19H13NO5/c1-22-11-4-3-10-14-13-9(7-12-19(14)25-8-24-12)5-6-20-16(13)17(21)15(10)18(11)23-2/h3-7H,8H2,1-2H3
InChI Key MRMACEXMVLHBJQ-UHFFFAOYSA-N
Purity 95%+
Complexity 542
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 335.07937252
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 335.07937252
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 66.9 Ų
Custom Q&A

What is the CAS number of oxocreabanine?

The CAS number of oxocreabanine is 38826-42-5.

What are some synonyms for oxocreabanine?

Some synonyms for oxocreabanine are 9,10-dimethoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one and 8H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one, 9,10-dimethoxy-.

What is the molecular formula of oxocreabanine?

The molecular formula is C19H13NO5.

What is the molecular weight of oxocreabanine?

The molecular weight is 335.31 g/mol.

What is the melting point of oxocreabanine?

The melting point is 274.4-276.7 °C.

What is the boiling point of oxocreabanine?

The boiling point is 598.2±50.0 °C (predicted).

What is the density of oxocreabanine?

The density is 1.449±0.06 g/cm3 (predicted).

What is the pka value of oxocreabanine?

The pka value is 1.74±0.20 (predicted).

※ Please kindly note that our products are for research use only.