Oxychelerythrine

Oxychelerythrine

Inquiry
Catalog Number ACM28342338
CAS Number 28342-33-8
Structure
Synonyms 1,2-Dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one
Molecular Weight 363.4
InChI InChI=1S/C21H17NO5/c1-22-19-13(5-4-11-8-16-17(9-14(11)19)27-10-26-16)12-6-7-15(24-2)20(25-3)18(12)21(22)23/h4-9H,10H2,1-3H3
InChI Key IHTXRYTWDARUKX-UHFFFAOYSA-N
Purity 95%+
Complexity 585
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 363.11067264
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 363.11067264
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical formula for 6-Oxochelerythrine?

The chemical formula for 6-Oxochelerythrine is C21H17NO5.

What is the molecular weight of 6-Oxochelerythrine?

The molecular weight of 6-Oxochelerythrine is 363.36.

What is the melting point of 6-Oxochelerythrine?

The melting point of 6-Oxochelerythrine is 194-197 °C.

In what forms is 6-Oxochelerythrine soluble?

6-Oxochelerythrine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the pka value of 6-Oxochelerythrine?

The pka value of 6-Oxochelerythrine is -1.58±0.20.

What activities does Oxychelerythrine show against Tribolium castaneum adults?

Oxychelerythrine shows antifeeding activities against Tribolium castaneum adults, with the EC50 of 1932 ppm.

What kind of modulatory activity does Oxychelerythrine show in enhancing susceptibility to antibiotics?

Oxychelerythrine shows high modulatory activity enhancing the susceptibility of the S. aureus ATCC 6538 to all the tested antibiotics from two to four-fold.

How is 6-Oxochelerythrine defined in terms of its chemical structure?

6-Oxochelerythrine is defined as a benzophenanthridine alkaloid.

What is the boiling point of 6-Oxochelerythrine?

The predicted boiling point of 6-Oxochelerythrine is 615.5±55.0 °C.

※ Please kindly note that our products are for research use only.