Oxyepiberberine

Oxyepiberberine

Inquiry
Catalog Number ACM19716600
CAS Number 19716-60-0
Structure
Synonyms 8-Oxo-epiberberine
Molecular Weight 351.4
InChI InChI=1S/C20H17NO5/c1-23-16-8-11-5-6-21-14(13(11)9-17(16)24-2)7-12-3-4-15-19(26-10-25-15)18(12)20(21)22/h3-4,7-9H,5-6,10H2,1-2H3
InChI Key PJTYPIGQKDTERS-UHFFFAOYSA-N
Purity 95%+
Complexity 607
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 351.11067264
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 351.11067264
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical formula of Oxyepiberberine?

The chemical formula of Oxyepiberberine is C20H17NO5.

What is the molecular weight of Oxyepiberberine?

The molecular weight of Oxyepiberberine is 351.35 g/mol.

What is the CAS number for Oxyepiberberine?

The CAS number for Oxyepiberberine is 19716-60-0.

What are some synonyms for Oxyepiberberine?

Some synonyms for Oxyepiberberine include 8-Oxo-epiberberine and 11,12-Dihydro-8,9-dimethoxy-14H-benzo[a]-1,3-benzodioxolo[4,5-g]quinolizin-14-one.

What is the predicted boiling point of Oxyepiberberine?

The predicted boiling point of Oxyepiberberine is 603.3±55.0 °C.

In what solvents is Oxyepiberberine soluble?

Oxyepiberberine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the predicted pKa of Oxyepiberberine?

The predicted pKa of Oxyepiberberine is -1.62±0.20.

What is the predicted density of Oxyepiberberine?

The predicted density of Oxyepiberberine is 1.44±0.1 g/cm3.

What is the physical form of Oxyepiberberine?

Oxyepiberberine is in powder form.

What are some potential applications of Oxyepiberberine?

Oxyepiberberine can potentially be used as an inhibitor due to its chemical properties.

※ Please kindly note that our products are for research use only.