Petasitenine

Petasitenine

Inquiry
Catalog Number ACM60102376
CAS Number 60102-37-6
Structure
Synonyms (15R,20R)-15,20-Epoxy-15,20-dihydro-12-hydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione
IUPAC Name (1R,3R,4R,6R,7R,11Z)-7-hydroxy-3,6,7,14-tetramethylspiro[2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-4,2-oxirane]-3,8,17-trione
Molecular Weight 381.4
Molecular Formula C19H27NO7
InChI InChI=1S/C19H27NO7/c1-11-9-19(12(2)27-19)17(23)26-14-6-8-20(4)7-5-13(15(14)21)10-25-16(22)18(11,3)24/h5,11-12,14,24H,6-10H2,1-4H3/b13-5-/t11-,12-,14-,18-,19-/m1/s1
InChI Key CZQLULNMKQAIQL-PFDMWMSASA-N
Boiling Point 614.7ºC at 760 mmHg
Melting Point 129.5 °C
Flash Point 325.6ºC
Purity 95%+
Density 1.29g/cm³
Complexity 690
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 5
Exact Mass 381.1787522
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 8
Hydrogen Bond Donor Count 1
Isomeric SMILES C[C@@H]1C[C@@]2([C@H](O2)C)C(=O)O[C@@H]3CCN(C/C=C(\C3=O)/COC(=O)[C@]1(C)O)C
Monoisotopic Mass 381.1787522
Packing Group III
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 106 Ų
Custom Q&A

What is the product name of the chemical compound with the CAS number 60102-37-6?

The product name is Petasitenine.

What are some synonyms for Petasitenine?

Some synonyms include Petasitenine, PETASITINENE, Fukinotoxin, and C10359.

What is the molecular formula of Petasitenine?

The molecular formula is C19H27NO7.

What is the molecular weight of Petasitenine?

The molecular weight is 381.42.

What is the melting point of Petasitenine?

The melting point is 129.5°C.

What is the boiling point of Petasitenine?

The boiling point is estimated to be 508.82°C.

What is the hazard class of Petasitenine according to safety information?

The hazard class is 6.1(b).

What is the Toxicity of Petasitenine?

The toxicity is mma-sat 1 mg/plate MUREAV 68,211,79.

What is a common source of petasitenine?

Petasitenine occurs in Petasites japonicus Maxim.

What is a safety concern related to Petasitenine?

It is a questionable carcinogen with experimental carcinogenic data.

※ Please kindly note that our products are for research use only.