Pilocarpine

Catalog Number	ACM92137
CAS Number	92-13-7
Structure
Synonyms	Syncarpine
IUPAC Name	(3S,4R)-3-Ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one
Molecular Weight	208.26
Molecular Formula	C11H16N2O2
Canonical SMILES	CCC1C(COC1=O)CC2=CN=CN2C
InChI	InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1
InChI Key	QCHFTSOMWOSFHM-WPRPVWTQSA-N
Purity	98%+ (HPLC)
Storage	Store in 2-8 °C.
Complexity	245
Exact Mass	208.121177757
Heavy Atom Count	15
Isomeric SMILES	CC[C@H]1[C@H](COC1=O)CC2=CN=CN2C
Monoisotopic Mass	208.121177757
Topological Polar Surface Area	44.1Ų

Custom Q&A

What is the chemical name and formula of pilocarpine?

Chemical name: Pilocarpine
Formula: C11H16N2O2

What is the molecular weight of pilocarpine?

The molecular weight of pilocarpine is 208.26

What is the melting point of pilocarpine?

The melting point of pilocarpine is 34°C

In which solvents is pilocarpine soluble?

Pilocarpine is soluble in chloroform and methanol

What is the primary use of pilocarpine in ophthalmology?

Pilocarpine is used as a myotic agent in ophthalmology

What receptors does pilocarpine stimulate?

Pilocarpine stimulates muscarinic receptors

What is the effect of atropine on the effects of pilocarpine?

The effects of pilocarpine are blocked by atropine

What is the historical background of the use of pilocarpine for treating glaucoma?

Pilocarpine has been used for hundreds of years to treat glaucoma

How is pilocarpine synthesized chemically?

Pilocarpine can be chemically synthesized through a multi-step process involving the conversion of various compounds

What is the safety hazard classification of pilocarpine?

Pilocarpine is classified as a Hazard Class 6.1 (b) substance

※ Please kindly note that our products are for research use only.