Piperlotine A

Piperlotine A

Inquiry
Catalog Number ACM389572707
CAS Number 389572-70-7
Structure
Synonyms 1-[(2E)-3-(4-Methoxyphenyl)-1-oxo-2-propenyl]pyrrolidine
IUPAC Name (E)-3-(4-methoxyphenyl)-1-pyrrolidin-1-ylprop-2-en-1-one
Molecular Weight 231.29
Molecular Formula C14H17NO2
Canonical SMILES COC1=CC=C(C=C1)/C=C/C(=O)N2CCCC2
InChI InChI=1S/C14H17NO2/c1-17-13-7-4-12(5-8-13)6-9-14(16)15-10-2-3-11-15/h4-9H,2-3,10-11H2,1H3/b9-6+
InChI Key JYEDISZKFNNREA-RMKNXTFCSA-N
Melting Point 117-118 °C
Purity 98%
Appearance Solid
Complexity 274
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 231.125928785
Heavy Atom Count 17
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Isomeric SMILES COC1=CC=C(C=C1)/C=C/C(=O)N2CCCC2
Monoisotopic Mass 231.125928785
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 29.5 Ų
Custom Q&A

What is the product name of this compound?

The product name is Piperlotine A.

What are some synonyms for Piperlotine A?

Some synonyms for Piperlotine A include 1-[(2E)-3-(4-Methoxyphenyl)-1-oxo-2-propenyl]pyrrolidine and 2-Propen-1-one, 3-(4-methoxyphenyl)-1-(1-pyrrolidinyl)-, (2E)-.

What is the CAS number for Piperlotine A?

The CAS number for Piperlotine A is 389572-70-7.

What is the molecular formula of Piperlotine A?

The molecular formula of Piperlotine A is C14H17NO2.

What is the molecular weight of Piperlotine A?

The molecular weight of Piperlotine A is 231.29.

What product category does Piperlotine A belong to?

Piperlotine A belongs to the category of alkaloids.

What is the melting point of Piperlotine A?

The melting point of Piperlotine A is 117-118℃.

What is the boiling point of Piperlotine A?

The predicted boiling point of Piperlotine A is 436.0±24.0 °C.

What is the predicted density of Piperlotine A?

The predicted density of Piperlotine A is 1.134±0.06 g/cm3.

What is the predicted pka value of Piperlotine A?

The predicted pka value of Piperlotine A is -0.88±0.20.

※ Please kindly note that our products are for research use only.