Piperlotine C

Catalog Number	ACM886989884
CAS Number	886989-88-4
Synonyms	(2E)-1-(1-Pyrrolidinyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one
Molecular Weight	291.34
InChI	InChI=1S/C16H21NO4/c1-19-13-10-12(11-14(20-2)16(13)21-3)6-7-15(18)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/b7-6+
InChI Key	TYFKYDTUEMTUNY-VOTSOKGWSA-N
Purity	95%+
Complexity	351
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	291.14705815
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)N2CCCC2
Monoisotopic Mass	291.14705815
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	48 Ų

Custom Q&A

What is the chemical name of Piperlotine C?

The chemical name of Piperlotine C is (2E)-1-(1-Pyrrolidinyl)-3-(3,4,5-trimethoxyphenyl)-2-propen-1-one.

What are the synonyms of Piperlotine C?

The synonyms of Piperlotine C are Piperlotine C and 2-Propen-1-one, 1-(1-pyrrolidinyl)-3-(3,4,5-trimethoxyphenyl)-, (2E)-.

What is the CAS number of Piperlotine C?

The CAS number of Piperlotine C is 886989-88-4.

What is the molecular formula of Piperlotine C?

The molecular formula of Piperlotine C is C16H21NO4.

What is the molecular weight of Piperlotine C?

The molecular weight of Piperlotine C is 291.34.

Under what product categories does Piperlotine C belong?

Piperlotine C belongs to the product category of alkaloids.

What is the structure of Piperlotine C?

The structure of Piperlotine C consists of a pyrrolidinyl group attached to a propenone group, with a trimethoxyphenyl group.

What is the chemical composition of Piperlotine C?

Piperlotine C is composed of carbon, hydrogen, nitrogen, and oxygen atoms in specific ratios to form the molecule.

※ Please kindly note that our products are for research use only.