piperolactam C

piperolactam C

Inquiry
Catalog Number ACM116064767
CAS Number 116064-76-7
Structure
Synonyms 3-Methoxyaristolactam BII
Molecular Weight 309.3
InChI InChI=1S/C18H15NO4/c1-21-15-12-10-7-5-4-6-9(10)8-11-13(12)14(18(20)19-11)16(22-2)17(15)23-3/h4-8H,1-3H3,(H,19,20)
InChI Key GYYIMUXZCUHECT-UHFFFAOYSA-N
Melting Point 189-190 °C
Purity 95%+
Complexity 470
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 309.10010796
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 309.10010796
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 56.8 Ų
Custom Q&A

What is the chemical formula of Piperolactam C?

The chemical formula is C18H15NO4.

What is the molecular weight of Piperolactam C?

The molecular weight is 309.32 g/mol.

What is the melting point of Piperolactam C?

The melting point is 189-190 °C.

What is the predicted boiling point of Piperolactam C?

The predicted boiling point is 467.2 ± 45.0 °C.

What is the predicted density of Piperolactam C?

The predicted density is 1.324 ± 0.06 g/cm3.

What is the pKa value of Piperolactam C?

The pKa value is 11.34 ± 0.20.

What are some synonyms for Piperolactam C?

Some synonyms include 2-O-Methylaristolactam FII, 3-Methoxyaristolactam BII, O-Methylpiperolactam B, and Piperolactam B methyl ether.

How is Piperolactam C defined by ChEBI?

Piperolactam C is defined as an alkaloid by ChEBI.

What is the CAS number of Piperolactam C?

The CAS number is 116064-76-7.

What is the chemical name of Piperolactam C?

The chemical name is Dibenz[cd,f]indol-4(5H)-one, 1,2,3-trimethoxy-.

※ Please kindly note that our products are for research use only.