Pirfenidone

Catalog Number	ACM53179138
CAS Number	53179-13-8
Structure
Synonyms	Esbriet
IUPAC Name	5-Methyl-1-phenylpyridin-2-one
Molecular Weight	185.22
Molecular Formula	C12H11NO
Canonical SMILES	CC1=CN(C(=O)C=C1)C2=CC=CC=C2
InChI	InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3
InChI Key	ISWRGOKTTBVCFA-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	285
Exact Mass	185.084063974
Heavy Atom Count	14
Monoisotopic Mass	185.084063974
Topological Polar Surface Area	20.3Ų

Custom Q&A

What is the chemical name of Pirfenidone?

The chemical name of Pirfenidone is 5-Methyl-1-phenylpyridine-2(1H)-one.

What is the boiling point of Pirfenidone?

The boiling point of Pirfenidone is predicted to be 329.1±15.0 °C.

What is the solubility of Pirfenidone in DMSO?

Pirfenidone is soluble to at least 10 mg/mL in DMSO.

What is the stability of Pirfenidone from the date of purchase?

Pirfenidone is stable for 2 years from the date of purchase.

How does Pirfenidone prevent fibrosis and scar formation?

Pirfenidone prevents fibrosis and scar formation by inhibiting collagen synthesis and reducing inflammation.

What cytokines does Pirfenidone regulate or inhibit?

Pirfenidone regulates or inhibits factors such as TGF-β, TNF-α, and various growth factors involved in fibrosis.

What are some clinical applications of Pirfenidone?

Clinical applications of Pirfenidone include treating idiopathic pulmonary fibrosis, liver fibrosis, renal fibrosis, multiple sclerosis, and neoplastic diseases.

How is Pirfenidone prepared?

Pirfenidone is prepared by synthesizing 5-methyl-2 (1H)-pyridone and then converting it to Pirfenidone through reactions with iodobenzene.

How does Pirfenidone affect collagen synthesis?

Pirfenidone inhibits the expression of proteins related to collagen synthesis, reducing the production of collagen fibers.

What are some common side effects of Pirfenidone?

Common side effects of Pirfenidone include light sensitivity, fatigue, rash, nausea, upper gastrointestinal discomfort, bloating, anorexia, diarrhea, and skin itching.

※ Please kindly note that our products are for research use only.