Pistaciamide

Catalog Number	ACM1029004838
CAS Number	1029004-83-8
IUPAC Name	4-Hydroxy-3-(2-oxopyrrolidin-1-yl)benzoic acid
Molecular Weight	221.21
Molecular Formula	C11H11NO4
Canonical SMILES	C1CC(=O)N(C1)C2=C(C=CC(=C2)C(=O)O)O
InChI	InChI=1S/C11H11NO4/c13-9-4-3-7(11(15)16)6-8(9)12-5-1-2-10(12)14/h3-4,6,13H,1-2,5H2,(H,15,16)
InChI Key	SMQZZRUGTUYBFY-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	304
Exact Mass	221.06880783
Heavy Atom Count	16
Monoisotopic Mass	221.06880783
Topological Polar Surface Area	77.8Ų

Custom Q&A

What is the chemical name of Pistaciamide?

The chemical name of Pistaciamide is Benzoic acid, 4-hydroxy-3-(2-oxo-1-pyrrolidinyl)-.

What is the CAS number for Pistaciamide?

The CAS number for Pistaciamide is 1029004-83-8.

What is the molecular formula of Pistaciamide?

The molecular formula of Pistaciamide is C11H11NO4.

What is the molecular weight of Pistaciamide?

The molecular weight of Pistaciamide is 221.21.

What are the different elements present in the molecular formula of Pistaciamide?

The elements present in the molecular formula of Pistaciamide are Carbon, Hydrogen, Nitrogen, and Oxygen.

What is the functional group present in the chemical structure of Pistaciamide?

The chemical structure of Pistaciamide contains a hydroxyl group and a pyrrolidinyl group.

※ Please kindly note that our products are for research use only.