Polycephalin C

Catalog Number	ACM220422377
CAS Number	220422-37-7
Structure
Synonyms	2,4-Pyrrolidinedione, 3,3'-[(1R,2R)-3-cyclohexene-1,2-diylbis[(2E,4E,6E)-1-hydroxy-2,4,6-heptatrien-7-yl-1-ylidene]]bis[5-(hydroxymethyl)-1-methyl-, (3E,3'E,5S,5'S)- (9CI)
Molecular Weight	576.6
InChI	InChI=1S/C32H36N2O8/c1-33-23(19-35)29(39)27(31(33)41)25(37)17-9-5-3-7-13-21-15-11-12-16-22(21)14-8-4-6-10-18-26(38)28-30(40)24(20-36)34(2)32(28)42/h3-11,13-15,17-18,21-24,35-38H,12,16,19-20H2,1-2H3/b5-3+,6-4+,13-7+,14-8+,17-9+,18-10+,27-25+,28-26+/t21-,22-,23+,24+/m1/s1
InChI Key	NMRXEMWZLVUIOR-CVEQOGDWSA-N
Purity	95%+
Complexity	1360
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	576.24716611
Heavy Atom Count	42
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	4
Isomeric SMILES	CN1[C@H](C(=O)/C(=C(/C=C/C=C/C=C/[C@@H]2CCC=C[C@H]2/C=C/C=C/C=C/C(=C\3/C(=O)[C@@H](N(C3=O)C)CO)/O)\O)/C1=O)CO
Monoisotopic Mass	576.24716611
PhysicalState	Powder
Rotatable Bond Count	10
Topological Polar Surface Area	156 Ų

Custom Q&A

What is the chemical name of Polycephalin C?

The chemical name of Polycephalin C is 2,4-Pyrrolidinedione, 3,3'-[(1R,2R)-3-cyclohexene-1,2-diylbis[(2E,4E,6E)-1-hydroxy-2,4,6-heptatrien-7-yl-1-ylidene]]bis[5-(hydroxymethyl)-1-methyl-, (3E,3'E,5S,5'S)-

What are the synonyms for Polycephalin C?

Polycephalin C; 2,4-Pyrrolidinedione, 3,3'-[(1R,2R)-3-cyclohexene-1,2-diylbis[(2E,4E,6E)-1-hydroxy-2,4,6-heptatrien-7-yl-1-ylidene]]bis[5-(hydroxymethyl)-1-methyl-, (3E,3'E,5S,5'S)-

What is the CAS number of Polycephalin C?

The CAS number of Polycephalin C is 220422-37-7.

What is the molecular formula of Polycephalin C?

The molecular formula of Polycephalin C is C32H36N2O8.

What is the molecular weight of Polycephalin C?

The molecular weight of Polycephalin C is 576.64.

What is the chemical structure of Polycephalin C?

The chemical structure of Polycephalin C is composed of a complex arrangement of various atoms, including carbon, hydrogen, nitrogen, and oxygen.

How is Polycephalin C typically prepared or synthesized?

Polycephalin C is typically prepared or synthesized through a series of chemical reactions involving specific reagents and reaction conditions.

What are some potential biological activities or uses of Polycephalin C?

Some potential biological activities of Polycephalin C may include anti-cancer, anti-inflammatory, or other pharmacological effects.

Are there any known interactions or side effects of Polycephalin C?

Further research may be needed to determine any potential interactions or side effects of Polycephalin C when used in biological systems.

※ Please kindly note that our products are for research use only.