Pramanicin

Pramanicin

Inquiry
Catalog Number ACM154445053
CAS Number 154445-05-3
Molecular Weight 369.5
InChI InChI=1S/C19H31NO6/c1-2-3-4-5-6-7-8-9-14-15(26-14)10-11-16(22)19(25)17(23)13(12-21)20-18(19)24/h10-11,13-15,17,21,23,25H,2-9,12H2,1H3,(H,20,24)
InChI Key BOWRHOKHYKPEAR-UHFFFAOYSA-N
Purity 95%+
Complexity 522
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 369.21513771
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 4
Monoisotopic Mass 369.21513771
PhysicalState Powder
Rotatable Bond Count 12
Topological Polar Surface Area 119 Ų
Custom Q&A

What is the significance of pramanicin in the field of chemistry?

Pramanicin is a compound with interesting biological properties that make it a valuable target for research in the pharmaceutical and medicinal chemistry fields.

What are some synonyms for pramanicin?

Some synonyms for pramanicin are 2-Pyrrolidinone, 3,4-dihydroxy-5-(hydroxymethyl)-3-[(2E)-3-[(2R,3R)-3-nonyl-2-oxiranyl]-1-oxo-2-propen-1-yl]-, (3S,4S,5S)-.

What is the molecular formula of pramanicin?

The molecular formula of pramanicin is C19H31NO6.

What is the molecular weight of pramanicin?

The molecular weight of pramanicin is 369.45.

What is the chemical structure of pramanicin?

The chemical structure of pramanicin consists of a 2-Pyrrolidinone ring with various hydroxyl and alkyl groups attached.

What is the stereochemistry of pramanicin?

The stereochemistry of pramanicin is (3S,4S,5S).

How many carbon atoms are present in the molecular formula of pramanicin?

There are 19 carbon atoms present in the molecular formula of pramanicin.

What functional groups are present in the chemical structure of pramanicin?

The chemical structure of pramanicin contains hydroxyl, alkyl, and carbonyl functional groups.

※ Please kindly note that our products are for research use only.