Pseudocoptisine (acetate)

Pseudocoptisine (acetate)

Inquiry
Catalog Number ACM30426665
CAS Number 30426-66-5
Synonyms Isocoptisine acetate
Molecular Weight 379.4
InChI InChI=1S/C19H14NO4.C2H4O2/c1-2-20-8-13-6-18-17(22-9-23-18)5-12(13)3-15(20)14-7-19-16(4-11(1)14)21-10-24-19;1-2(3)4/h3-8H,1-2,9-10H2;1H3,(H,3,4)/q+1;/p-1
InChI Key FRCAGGREKGATCY-UHFFFAOYSA-M
Purity 90%+
Complexity 527
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 379.10558726
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 379.10558726
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 80.9 Ų
Custom Q&A

What is another name for Isocoptisine acetate?

Pseudocoptisine acetate

What is the CAS number for Isocoptisine acetate?

30426-66-5

What is the molecular formula of Isocoptisine acetate?

C21H17NO6

What is the molecular weight of Isocoptisine acetate?

379.37

What is the melting point of Isocoptisine acetate?

146-147 °C

What is the recommended storage temperature for Isocoptisine acetate?

Store at -20°C

In what solvent is Isocoptisine acetate soluble?

DMSO

What is the chemical structure of Isocoptisine acetate?

It is not specified in the given information.

Is Isocoptisine acetate a naturally occurring compound or a synthetic one?

It is not specified in the given information.

What potential applications or uses does Isocoptisine acetate have?

It is not specified in the given information.

※ Please kindly note that our products are for research use only.