Pseudocoptisine chloride

Pseudocoptisine chloride

Inquiry
Catalog Number ACM30044781
CAS Number 30044-78-1
Molecular Weight 355.8
InChI InChI=1S/C19H14NO4.ClH/c1-2-20-8-13-6-18-17(22-9-23-18)5-12(13)3-15(20)14-7-19-16(4-11(1)14)21-10-24-19;/h3-8H,1-2,9-10H2;1H/q+1;/p-1
InChI Key QBOVLUUBUAZWIN-UHFFFAOYSA-M
Purity 95%+
Complexity 502
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 355.0611356
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 355.0611356
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the chemical formula of Pseudocoptisine chloride?

The chemical formula of Pseudocoptisine chloride is C19H14ClNO4.

What is the molecular weight of Pseudocoptisine chloride?

The molecular weight of Pseudocoptisine chloride is 355.77 g/mol.

Where can Pseudocoptisine chloride be stored?

Pseudocoptisine chloride can be stored at -20°C.

What is the biological activity of Pseudocoptisine chloride?

Pseudocoptisine chloride inhibits acetylcholinesterase (AChE) activity and has anti-inflammatory and anti-amnestic effects.

How does Pseudocoptisine chloride inhibit NO production in RAW264.7 cells?

Pseudocoptisine chloride dose-dependently inhibits LPS-induced NO production in RAW264.7 cells.

What are the effects of Pseudocoptisine chloride on the production of TNF-α and IL-6 in RAW264.7 cells?

Pseudocoptisine chloride significantly reduces the LPS-induced TNF-α and IL-6 production and their mRNA expressions in RAW264.7 cells.

How does Pseudocoptisine chloride reduce levels of pro-inflammatory mediators in RAW264.7 cells?

Pseudocoptisine chloride reduces levels of pro-inflammatory mediators by inhibiting NF-kappaB activation through the suppression of ERK and p38 phosphorylation in RAW264.7 cells.

What are the in vivo effects of Pseudocoptisine on learning and memory impairments in mice?

Pseudocoptisine significantly reverses cognitive impairments induced by scopolamine in mice by passive avoidance test.

What is the IC50 value of Pseudocoptisine chloride for inhibiting AChE activity?

The IC50 value of Pseudocoptisine chloride for inhibiting AChE activity is 12.8 μM.

What is the source of Pseudocoptisine chloride?

Pseudocoptisine chloride is a quaternary alkaloid with a benzylisoquinoline skeleton that is isolated from Corydalis Tuber.

※ Please kindly note that our products are for research use only.