Pseudojervine

Catalog Number	ACM36069053
CAS Number	36069-05-3
Structure
Molecular Weight	587.7
InChI	InChI=1S/C33H49NO8/c1-15-11-22-26(34-13-15)17(3)33(42-22)10-8-20-21-6-5-18-12-19(40-31-30(39)29(38)27(36)23(14-35)41-31)7-9-32(18,4)25(21)28(37)24(20)16(33)2/h5,15,17,19-23,25-27,29-31,34-36,38-39H,6-14H2,1-4H3/t15-,17+,19-,20-,21-,22+,23+,25+,26-,27+,29-,30+,31+,32-,33-/m0/s1
InChI Key	HYDDDNUKNMMWBD-VPLHBGEQSA-N
Melting Point	300-301 °C
Purity	90%+
Complexity	1170
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	15
Exact Mass	587.34581752
Heavy Atom Count	42
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	5
Isomeric SMILES	C[C@H]1C[C@@H]2[C@H]([C@H]([C@]3(O2)CC[C@H]4[C@@H]5CC=C6C[C@H](CC[C@@]6([C@H]5C(=O)C4=C3C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)NC1
Monoisotopic Mass	587.34581752
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	138 Ų

Custom Q&A

What is the chemical formula and molecular weight of Pseudojervine?

The chemical formula of Pseudojervine is C33H49NO8, and its molecular weight is 587.749.

What is the melting point of Pseudojervine?

The melting point of Pseudojervine is 300-301°C (dec).

How is Pseudojervine synthesized?

Pseudojervine is an alkaloid found in Veratrum album and V. viride Ait. It is hydrolyzed to glucose and isojervine when boiled with dilute HCl.

What physical form does Pseudojervine crystallize into?

Pseudojervine crystallizes from EtOH in hexagonal tablets.

What is the specific rotation of Pseudojervine in CHCl3?

The specific rotation of Pseudojervine in CHCl3 is [α]20D - 139°.

What is the refractive index of Pseudojervine?

The estimated refractive index of Pseudojervine is 1.5960.

How many replaceable hydrogen atoms does Pseudojervine contain?

Pseudojervine contains five replaceable hydrogen atoms.

What is the predicted pKa of Pseudojervine?

The predicted pKa of Pseudojervine is 12.91±0.70.

What are some of the derivatives of Pseudojervine that have been reported?

Poethke showed that Pseudojervine gives a nitro so derivative with a melting point of 261°C.

How is Pseudojervine classified according to ChEBI?

Pseudojervine is classified as a steroid saponin by ChEBI.

※ Please kindly note that our products are for research use only.