Pteropodine

Catalog Number	ACM5629607-1
CAS Number	5629-60-7
Synonyms	Uncarine c
IUPAC Name	Methyl (1S,4aS,5aS,6R,10aS)-1-methyl-2'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,3'-1H-indole]-4-carboxylate
Molecular Weight	368.43
Molecular Formula	C21H24N2O4
Canonical SMILES	CC1C2CN3CCC4(C3CC2C(=CO1)C(=O)OC)C5=CC=CC=C5NC4=O
InChI	InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14-,18-,21+/m0/s1
InChI Key	JMIAZDVHNCCPDM-QLMFUGSGSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	692
Exact Mass	368.17360725
Heavy Atom Count	27
Isomeric SMILES	C[C@H]1[C@@H]2CN3CC[C@]4([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)C5=CC=CC=C5NC4=O
Monoisotopic Mass	368.17360725
Topological Polar Surface Area	67.9Ų

Custom Q&A

What is the product name of Pteropodine?

The product name is UNCARINE C.

What are some synonyms for Pteropodine?

Some synonyms for Pteropodine include Isospeciophylline and Spiro[3H-indole-3,6'(4'aH)-[1H]pyrano[3,4-f]indolizine]-4'-carboxylic acid methyl ester.

What is the CAS number for Pteropodine?

The CAS number for Pteropodine is 5629-60-7.

What is the chemical formula of Pteropodine?

The chemical formula of Pteropodine is C21H24N2O4.

What is the melting point of Pteropodine?

The melting point of Pteropodine is 217-219℃.

What are some common uses of Pteropodine?

Pteropodine is a compound extracted from Uncaria tomentosa leaves which exhibit immunomodulating, anti-inflammatory, and anti-cancer activity.

What is the density of Pteropodine at 20 ºC?

The density of Pteropodine is 1.33±0.1 g/cm3 at 20 ºC.

How is Pteropodine isolated?

Pteropodine is isolated from Uncaria pteropoda.

What is the specific rotation of Pteropodine in chloroform solution?

Pteropodine has a specific rotation of [α]29DJ 9 - 102.5° in chloroform.

What are some other references related to the study of Pteropodine?

Some references related to Pteropodine include Shamma et al., Tetrahedron Lett., 1966 and Yeoh, Chan, Morsingh., 1. Chem. Soc., C, 1966.

※ Please kindly note that our products are for research use only.