Raltegravir

Catalog Number	ACM518048050-2
CAS Number	518048-05-0
Synonyms	Isentress
IUPAC Name	N-[2-[4-[(4-Fluorophenyl)methylcarbamoyl]-5-hydroxy-1-methyl-6-oxopyrimidin-2-yl]propan-2-yl]-5-methyl-1,3,4-oxadiazole-2-carboxamide
Molecular Weight	444.42
Molecular Formula	C20H21FN6O5
Canonical SMILES	CC1=NN=C(O1)C(=O)NC(C)(C)C2=NC(=C(C(=O)N2C)O)C(=O)NCC3=CC=C(C=C3)F
InChI	InChI=1S/C20H21FN6O5/c1-10-25-26-17(32-10)16(30)24-20(2,3)19-23-13(14(28)18(31)27(19)4)15(29)22-9-11-5-7-12(21)8-6-11/h5-8,28H,9H2,1-4H3,(H,22,29)(H,24,30)
InChI Key	CZFFBEXEKNGXKS-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	836
Exact Mass	444.15574595
Heavy Atom Count	32
Monoisotopic Mass	444.15574595
Topological Polar Surface Area	150Ų

Custom Q&A

What is the chemical formula for Raltegravir?

The chemical formula for Raltegravir is C20H21FN6O5.

What is the melting point of Raltegravir?

The melting point of Raltegravir is 216°C.

What is the storage temperature recommended for Raltegravir?

Raltegravir should be stored at -20°C in a freezer.

How is Raltegravir primarily metabolized in the body?

Raltegravir is primarily metabolized through hepatic glucuronidation mediated by the UGT-1A1 enzyme.

What are the most common adverse reactions associated with Raltegravir?

The most common adverse reactions linked to Raltegravir are diarrhea, nausea, and headache.

What is the mode of action of Raltegravir in treating HIV-1 infection?

Raltegravir inhibits the necessary HIV integrase for viral replication, thereby slowing down HIV-1 infection.

What is the main safety concern related to Raltegravir use?

Some patients who take Raltegravir may experience abnormal muscle enzyme levels as shown in blood tests.

What type of drug is Raltegravir classified as?

Raltegravir is classified as an antiretroviral drug and a HIV-1 integrase inhibitor.

Which company originated Raltegravir?

Raltegravir was originated by Merck in the United States.

How is Raltegravir excreted from the body?

Raltegravir is excreted in the feces (51%) and the urine (32%) as both the unchanged compound and its glucuronide metabolite.

※ Please kindly note that our products are for research use only.