Rauvomitin

Catalog Number	ACM466579
CAS Number	466-57-9
Synonyms	(17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate
Molecular Weight	502.6
InChI	InChI=1S/C30H34N2O5/c1-6-16-15-32-21-13-18(16)25-22(32)14-30(19-9-7-8-10-20(19)31(2)27(21)30)28(25)37-29(33)17-11-23(34-3)26(36-5)24(12-17)35-4/h6-12,18,21-22,25,27-28H,13-15H2,1-5H3/b16-6-/t18-,21-,22-,25+,27,28,30+/m0/s1
InChI Key	JHWXXJLDNKFDNH-HZBSNRRDSA-N
Melting Point	115-117 °C
Purity	95%+
Complexity	942
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	502.24677219
Heavy Atom Count	37
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@@H]4[C@@H]2C[C@@]5(C3N(C6=CC=CC=C65)C)C4OC(=O)C7=CC(=C(C(=C7)OC)OC)OC
Monoisotopic Mass	502.24677219
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	60.5 Ų

Custom Q&A

What is the chemical name of the compound with the synonym Rauvomitin?

The chemical name is (17R,19E)-19,20-Didehydroajmalan-17-ol 3,4,5-trimethoxybenzoate.

What is the CAS number of Rauvomitin?

The CAS number is 466-57-9.

What is the molecular formula of Rauvomitin?

The molecular formula is C30H34N2O5.

What is the melting point of Rauvomitin?

The melting point is 115-117°C.

In what solvents is Rauvomitin soluble?

Rauvomitin is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of Rauvomitin?

Rauvomitin is in powder form.

Where is Rauvomitin found and what is the crystal color?

Rauvomitin is found in Rauwolfia vomitora and the base yields colorless crystals from MeOH.

What is the specific rotation of Rauvomitin in CHCl3?

The specific rotation is [α]D - 173.4° ± 1° (c 1.0, CHCl 3).

What is the m.p of Rauvomitin hydrochloride?

The hydrochloride has a melting point of 223°C (dec.).

What compounds are obtained from the acid hydrolysis of Rauvomitin base?

Tetraphyllicine and gallic acid trimethyl ether are obtained from the acid hydrolysis of the base.

※ Please kindly note that our products are for research use only.