Rinderine

Catalog Number	ACM6029841
CAS Number	6029-84-1
Synonyms	(7-Hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl)methyl 2-hydroxy-2-(1 -hydroxyethyl)-3-methyl-butanoate
Molecular Weight	299.36
InChI	InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12+,13-,15+/m1/s1
InChI Key	SFVVQRJOGUKCEG-ZRQNBYAXSA-N
Purity	95%+
Complexity	436
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	299.1732729
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@H]([C@@](C(C)C)(C(=O)OCC1=CCN2[C@H]1[C@H](CC2)O)O)O
Monoisotopic Mass	299.1732729
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	90.2 Ų

Custom Q&A

What is the chemical name of the compound with the synonym Rinderine?

The chemical name is (7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl)methyl 2-hydroxy-2-(1 -hydroxyethyl)-3-methyl-butanoate.

What is the molecular formula of Rinderine?

The molecular formula is C15H25NO5.

What is the melting point of Rinderine?

The melting point is 100-101°C.

What is the boiling point of Rinderine?

The boiling point is predicted to be 463.3±45.0 °C.

How many non-phenolic hydroxyl groups are present in Rinderine?

Three non-phenolic hydroxyl groups are present in Rinderine.

What are some well crystalline salts of Rinderine with mineral acids and their melting points?

Some well crystalline salts include the hydrochloride (m.p. 152-153°C), hydrobromide (m.p. 123-124°C), and hydriodide (m.p. 118-119°C).

What is the structure of Rinderine based on the hydrolysis products?

The structure may be deduced from the hydrolysis products, which are heliotridine and (+)-trachelanthic acid.

What class of compounds does Rinderine belong to?

Rinderine is a pyrrolizidine alkaloid, which is a class of compounds used as defense mechanisms in several plant families.

How is Rinderine used in nature?

Rinderine may be used by insects as a defense mechanism, sequestered from food for their own defense, and found in some medicinal herb preparations.

※ Please kindly note that our products are for research use only.