Rosmarinine

Catalog Number	ACM520650
CAS Number	520-65-0
Molecular Weight	353.41
InChI	InChI=1S/C18H27NO6/c1-4-11-7-10(2)18(3,23)17(22)24-9-12-13(20)8-19-6-5-14(15(12)19)25-16(11)21/h4,10,12-15,20,23H,5-9H2,1-3H3/b11-4-/t10-,12+,13-,14-,15-,18-/m1/s1
InChI Key	YEXVXKIMPBHRQR-VFQWDWSUSA-N
Melting Point	208 °C
Purity	95%+
Complexity	590
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	353.18383758
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/C[C@H]([C@@](C(=O)OC[C@H]2[C@@H](CN3[C@H]2[C@@H](CC3)OC1=O)O)(C)O)C
Monoisotopic Mass	353.18383758
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the chemical formula for Rosmarinine?

The chemical formula for Rosmarinine is C18H27NO6.

What is the molecular weight of Rosmarinine?

The molecular weight of Rosmarinine is 353.41.

What is the melting point of Rosmarinine?

The melting point of Rosmarinine is 208°C.

Where is Rosmarinine isolated from?

Rosmarinine is a pyrrolizidine alkaloid isolated from Senecio rosmarinifolium Linn.

How does Rosmarinine crystallize?

Rosmarinine crystallizes as glistening laminae from either EtOH or Me2CO.

What is the specific rotation of Rosmarinine in MeOH?

The specific rotation of Rosmarinine in MeOH is [α]24D -91.5°.

What is the chemical property of Rosmarinine when alkaline hydrolysis is performed?

When alkaline hydrolysis is performed, Rosmarinine furnishes rosmarinecine and senecic acid.

How does Rosmarinine yield a crystalline nitrate?

Rosmarinine yields a crystalline nitrate with a melting point of 218°C.

What is the classification of Rosmarinine in ChEBI?

Rosmarinine is classified as a macrolide in ChEBI.

What are the references mentioned for Rosmarinine in the description?

The references mentioned for Rosmarinine in the description are Richardson, Warren (J. Chem. Soc., 452 (1943)) and Kropman, Warren (ibid, 700 (1950)).

※ Please kindly note that our products are for research use only.